The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-dichloro-N-(2,4-difluoro-3-((3-methoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)ethynyl)phenyl)benzenesulfonamide ID: ALA4088739
PubChem CID: 137644903
Max Phase: Preclinical
Molecular Formula: C21H12Cl2F2N4O3S
Molecular Weight: 509.32
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1n[nH]c2ncc(C#Cc3c(F)ccc(NS(=O)(=O)c4cccc(Cl)c4Cl)c3F)cc12
Standard InChI: InChI=1S/C21H12Cl2F2N4O3S/c1-32-21-13-9-11(10-26-20(13)27-28-21)5-6-12-15(24)7-8-16(19(12)25)29-33(30,31)17-4-2-3-14(22)18(17)23/h2-4,7-10,29H,1H3,(H,26,27,28)
Standard InChI Key: PVDAJIQBDSEKPR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
25.9339 -16.9879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5256 -16.2754 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.1127 -16.9852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6699 -16.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6688 -17.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3836 -17.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1000 -17.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0972 -16.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3817 -15.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8101 -15.8690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2390 -15.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3793 -15.0500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9540 -17.5272 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9553 -15.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2373 -15.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5227 -15.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5264 -14.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8127 -13.8139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8148 -15.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1003 -15.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1004 -14.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3086 -13.9659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8191 -14.6396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3084 -15.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0534 -16.0978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2464 -16.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9535 -16.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6660 -15.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6633 -15.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9422 -14.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2328 -15.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5151 -14.6367 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.9363 -13.8018 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 2 1 0
2 11 1 0
9 12 1 0
5 13 1 0
4 14 1 0
14 15 3 0
15 16 1 0
16 17 2 0
17 18 1 0
18 21 2 0
20 19 2 0
19 16 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 20 1 0
24 25 1 0
25 26 1 0
11 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 11 1 0
31 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.32Molecular Weight (Monoisotopic): 507.9975AlogP: 4.75#Rotatable Bonds: 4Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.93CX Basic pKa: 0.84CX LogP: 4.99CX LogD: 4.89Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -1.91
References 1. Chang Y, Lu X, Shibu MA, Dai YB, Luo J, Zhang Y, Li Y, Zhao P, Zhang Z, Xu Y, Tu ZC, Zhang QW, Yun CH, Huang CY, Ding K.. (2017) Structure Based Design of N-(3-((1H-Pyrazolo[3,4-b]pyridin-5-yl)ethynyl)benzenesulfonamides as Selective Leucine-Zipper and Sterile-α Motif Kinase (ZAK) Inhibitors., 60 (13): [PMID:28586211 ] [10.1021/acs.jmedchem.7b00572 ]