6-(3-(Pyrrolidin-1-yl)propoxy)-2-phenylbenzo[d]oxazole

ID: ALA4088775

PubChem CID: 137642761

Max Phase: Preclinical

Molecular Formula: C20H22N2O2

Molecular Weight: 322.41

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(-c2nc3ccc(OCCCN4CCCC4)cc3o2)cc1

Standard InChI:  InChI=1S/C20H22N2O2/c1-2-7-16(8-3-1)20-21-18-10-9-17(15-19(18)24-20)23-14-6-13-22-11-4-5-12-22/h1-3,7-10,15H,4-6,11-14H2

Standard InChI Key:  CEMLVWCAMWKAPN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   13.9146  -12.3284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3988  -11.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9146  -11.0053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1373  -11.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1373  -12.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4241  -12.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7150  -12.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7150  -11.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4241  -10.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2201  -11.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6287  -10.9603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4501  -10.9603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8587  -11.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4501  -12.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6287  -12.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0059  -12.4882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2968  -12.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5836  -12.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8745  -12.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1655  -12.4882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0814  -13.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2789  -13.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8662  -12.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4182  -12.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  5  6  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  2 10  1  0
 17 18  1  0
 18 19  1  0
 16 17  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 20 24  1  0
 19 20  1  0
  7 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4088775

    ---

Associated Targets(Human)

TLR9 Tclin Toll-like receptor 9 (943 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.41Molecular Weight (Monoisotopic): 322.1681AlogP: 4.36#Rotatable Bonds: 6
Polar Surface Area: 38.50Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.27CX LogP: 3.67CX LogD: 1.81
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -1.54

References

1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A..  (2017)  Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism.,  134  [PMID:28437629] [10.1016/j.ejmech.2017.03.086]

Source