The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-(2,6-Difluoro-benzylsulfanyl)-3-(4-fluoro-phenyl)-3H-imidazol-4-yl]-(3,4-dichloro-phenyl)-methyl-amine ID: ALA4088938
PubChem CID: 118586280
Max Phase: Preclinical
Molecular Formula: C23H16Cl2F3N3S
Molecular Weight: 494.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(c1ccc(Cl)c(Cl)c1)c1cnc(SCc2c(F)cccc2F)n1-c1ccc(F)cc1
Standard InChI: InChI=1S/C23H16Cl2F3N3S/c1-30(16-9-10-18(24)19(25)11-16)22-12-29-23(31(22)15-7-5-14(26)6-8-15)32-13-17-20(27)3-2-4-21(17)28/h2-12H,13H2,1H3
Standard InChI Key: OTECHJIJAUHLNR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
9.4179 -6.5568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5152 -6.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8494 -6.7932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1928 -6.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4492 -5.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2664 -5.5348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8494 -7.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5523 -8.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5503 -8.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8381 -9.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1362 -8.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1383 -8.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2981 -6.5780 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.8765 -5.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6656 -6.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2550 -5.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0366 -5.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2371 -6.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6477 -7.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8586 -7.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2802 -7.5965 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0588 -4.8686 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.8125 -6.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9884 -5.2116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3838 -4.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6047 -4.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4337 -5.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0396 -6.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2451 -7.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8327 -10.0619 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6565 -5.9685 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.9986 -4.3644 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
2 6 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
3 7 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
13 14 1 0
20 21 1 0
2 13 1 0
1 4 1 0
16 22 1 0
1 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
1 29 1 0
10 30 1 0
27 31 1 0
26 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.37Molecular Weight (Monoisotopic): 493.0394AlogP: 7.66#Rotatable Bonds: 6Polar Surface Area: 21.06Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.15CX LogP: 8.06CX LogD: 8.06Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -1.86
References 1. Lasalle M, Hoguet V, Hennuyer N, Leroux F, Piveteau C, Belloy L, Lestavel S, Vallez E, Dorchies E, Duplan I, Sevin E, Culot M, Gosselet F, Boulahjar R, Herledan A, Staels B, Deprez B, Tailleux A, Charton J.. (2017) Topical Intestinal Aminoimidazole Agonists of G-Protein-Coupled Bile Acid Receptor 1 Promote Glucagon Like Peptide-1 Secretion and Improve Glucose Tolerance., 60 (10): [PMID:28414465 ] [10.1021/acs.jmedchem.6b01873 ]