1-((6-aminopyridin-3-yl)methyl)-3-(4-morpholinophenylamino)-4-phenyl-1H-pyrrole-2,5-dione

ID: ALA4089430

PubChem CID: 11294005

Max Phase: Preclinical

Molecular Formula: C26H25N5O3

Molecular Weight: 455.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ccc(CN2C(=O)C(Nc3ccc(N4CCOCC4)cc3)=C(c3ccccc3)C2=O)cn1

Standard InChI:  InChI=1S/C26H25N5O3/c27-22-11-6-18(16-28-22)17-31-25(32)23(19-4-2-1-3-5-19)24(26(31)33)29-20-7-9-21(10-8-20)30-12-14-34-15-13-30/h1-11,16,29H,12-15,17H2,(H2,27,28)

Standard InChI Key:  JDHWLVUZCIEPGC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   16.8581   -7.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6802   -7.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0209   -8.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5317   -9.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7097   -9.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3768   -8.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8688   -9.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6729  -10.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7628  -10.9806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0043  -11.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4567  -10.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6367  -10.7871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3009  -11.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4787  -11.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1459  -12.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6326  -13.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4520  -12.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7877  -12.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3018  -13.8024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4858  -13.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1483  -14.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6348  -15.3155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4555  -15.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7890  -14.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8322  -12.1210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4736  -11.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1868  -10.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1868  -10.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8984   -9.7331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6143  -10.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6143  -10.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8984  -11.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3260   -9.7410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2833   -9.6122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
  7 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 19 24  1  0
 10 25  2  0
  9 26  1  0
 26 27  1  0
 27 28  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 30 33  1  0
  8 34  2  0
M  END

Associated Targets(Human)

ABCB11 Tchem Bile salt export pump (2311 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.52Molecular Weight (Monoisotopic): 455.1957AlogP: 2.89#Rotatable Bonds: 6
Polar Surface Area: 100.79Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.68CX Basic pKa: 6.50CX LogP: 2.33CX LogD: 2.28
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -1.00

References

1. Warner DJ, Chen H, Cantin LD, Kenna JG, Stahl S, Walker CL, Noeske T..  (2012)  Mitigating the inhibition of human bile salt export pump by drugs: opportunities provided by physicochemical property modulation, in silico modeling, and structural modification.,  40  (12): [PMID:22961681] [10.1124/dmd.112.047068]

Source