(8R,9S,10R,13S,14S,16S,E)-17-ethylidene-10,13-dimethyl-16-(4-p-tolyl-1H-1,2,3-triazol-1-yl)-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one

ID: ALA4089535

PubChem CID: 137643034

Max Phase: Preclinical

Molecular Formula: C30H37N3O

Molecular Weight: 455.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C1/[C@@H](n2cc(-c3ccc(C)cc3)nn2)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C30H37N3O/c1-5-24-28(33-18-27(31-32-33)20-8-6-19(2)7-9-20)17-26-23-11-10-21-16-22(34)12-14-29(21,3)25(23)13-15-30(24,26)4/h5-9,16,18,23,25-26,28H,10-15,17H2,1-4H3/b24-5-/t23-,25+,26+,28+,29+,30-/m1/s1

Standard InChI Key:  FGQHPRQYIULEFG-MKGWWAPGSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   17.6879   -5.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6879   -6.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4004   -6.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4004   -4.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1129   -5.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1094   -6.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8187   -6.5461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5360   -6.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8257   -4.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5395   -5.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5564   -3.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8311   -4.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2703   -4.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2569   -4.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0390   -5.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5332   -4.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0606   -3.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3525   -4.5346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8283   -5.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6170   -4.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6303   -4.1405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8498   -3.8745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3268   -3.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7835   -2.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2653   -3.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2487   -5.7371    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.5316   -4.4935    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.8186   -5.7205    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.1056   -4.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9735   -6.5464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2769   -5.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1723   -6.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8317   -6.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5920   -6.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6888   -5.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0284   -5.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2529   -6.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  2  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 16 18  1  1
 17 23  2  0
 23 24  1  0
 13 25  1  1
 14 26  1  6
 10 27  1  1
  9 28  1  6
  5 29  1  1
  2 30  2  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 20 31  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4089535

    ---

Associated Targets(non-human)

LLC-PK1 (2135 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.65Molecular Weight (Monoisotopic): 455.2937AlogP: 6.88#Rotatable Bonds: 2
Polar Surface Area: 47.78Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.78CX LogD: 6.78
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: 0.87

References

1. Lee D, Kim T, Kim KH, Ham J, Jang TS, Kang KS, Lee JW..  (2017)  Evaluation of guggulsterone derivatives as novel kidney cell protective agents against cisplatin-induced nephrotoxicity.,  27  (14): [PMID:28552338] [10.1016/j.bmcl.2017.05.033]

Source