2-Amino-N-(2-methoxyphenyl)-6-((4-nitrophenyl)sulfinyl)benzamide

ID: ALA4089701

PubChem CID: 118483240

Max Phase: Preclinical

Molecular Formula: C20H17N3O5S

Molecular Weight: 411.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1NC(=O)c1c(N)cccc1[S+]([O-])c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C20H17N3O5S/c1-28-17-7-3-2-6-16(17)22-20(24)19-15(21)5-4-8-18(19)29(27)14-11-9-13(10-12-14)23(25)26/h2-12H,21H2,1H3,(H,22,24)

Standard InChI Key:  RLPYZPHXEXUCSV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   16.3273  -17.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0372  -16.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3314  -18.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0372  -18.4363    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.0289  -21.6886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0372  -15.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0289  -20.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7388  -15.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0248  -19.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3273  -22.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6298  -16.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7306  -22.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7388  -17.2105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7430  -18.0401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7388  -14.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7306  -20.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3314  -20.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7306  -19.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3314  -19.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6298  -15.9971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6298  -18.4239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0289  -14.3545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9282  -18.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9282  -17.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4322  -15.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4322  -14.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3149  -14.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1380  -15.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1380  -14.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  7  1  0
  6  2  1  0
  7 17  2  0
  8  6  1  0
  9  4  1  0
 10  5  1  0
 11  1  2  0
 12  5  2  0
 13  2  2  0
 14  4  1  0
 15  8  1  0
 16 18  2  0
 17 19  1  0
 18  9  1  0
 19  9  2  0
 20 11  1  0
 21  3  2  0
 22 15  1  0
 23 24  2  0
 24 11  1  0
 25  8  2  0
 26 15  2  0
 27 22  1  0
 28 25  1  0
 29 28  2  0
 23 21  1  0
  7 16  1  0
 29 26  1  0
M  CHG  4   4   1   5   1  10  -1  14  -1
M  END

Associated Targets(Human)

H9 (1832 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.44Molecular Weight (Monoisotopic): 411.0889AlogP: 3.60#Rotatable Bonds: 6
Polar Surface Area: 130.55Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.41CX LogP: 3.48CX LogD: 3.48
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.28Np Likeness Score: -0.97

References

1. Zhou M, Luo RH, Hou XY, Wang RR, Yan GY, Chen H, Zhang RH, Shi JY, Zheng YT, Li R, Wei YQ..  (2017)  Synthesis, biological evaluation and molecular docking study of N-(2-methoxyphenyl)-6-((4-nitrophenyl)sulfonyl)benzamide derivatives as potent HIV-1 Vif antagonists.,  129  [PMID:28235704] [10.1016/j.ejmech.2017.01.010]

Source