The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-Hydroxy-2-(4-methoxyphenylimino)-2H-chromene-3-carboxylic Acid [3-(3-Hydroxyphenyl)propyl]amide ID: ALA4089816
PubChem CID: 137642578
Max Phase: Preclinical
Molecular Formula: C26H24N2O5
Molecular Weight: 444.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/N=c2\oc3cc(O)ccc3cc2C(=O)NCCCc2cccc(O)c2)cc1
Standard InChI: InChI=1S/C26H24N2O5/c1-32-22-11-8-19(9-12-22)28-26-23(15-18-7-10-21(30)16-24(18)33-26)25(31)27-13-3-5-17-4-2-6-20(29)14-17/h2,4,6-12,14-16,29-30H,3,5,13H2,1H3,(H,27,31)/b28-26-
Standard InChI Key: PTJHHAABQXVCFD-SGEDCAFJSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.6772 -18.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6760 -19.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3841 -19.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3823 -18.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0909 -18.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0897 -19.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7998 -19.9457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5156 -19.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5168 -18.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8022 -18.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2222 -19.9470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2255 -18.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9322 -18.7147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2275 -17.4872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6409 -18.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3476 -18.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0563 -18.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7631 -18.7217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7561 -19.5394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4620 -19.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1717 -19.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1711 -18.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4646 -18.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4596 -20.7668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9680 -19.9404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2199 -20.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5088 -21.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5061 -21.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2132 -22.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9244 -21.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9236 -21.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2120 -23.2138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5037 -23.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
8 11 2 0
9 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 24 1 0
2 25 1 0
11 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.49Molecular Weight (Monoisotopic): 444.1685AlogP: 4.45#Rotatable Bonds: 7Polar Surface Area: 104.29Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.75CX Basic pKa: 1.49CX LogP: 4.64CX LogD: 4.48Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.53
References 1. Endo S, Xia S, Suyama M, Morikawa Y, Oguri H, Hu D, Ao Y, Takahara S, Horino Y, Hayakawa Y, Watanabe Y, Gouda H, Hara A, Kuwata K, Toyooka N, Matsunaga T, Ikari A.. (2017) Synthesis of Potent and Selective Inhibitors of Aldo-Keto Reductase 1B10 and Their Efficacy against Proliferation, Metastasis, and Cisplatin Resistance of Lung Cancer Cells., 60 (20): [PMID:28976752 ] [10.1021/acs.jmedchem.7b00830 ]