The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(2-bromophenyl)-2-(2-(4-methoxyphenyl)acetamido)-N-((S)-1-phenylethyl)propanamide ID: ALA4089982
PubChem CID: 118987011
Max Phase: Preclinical
Molecular Formula: C26H27BrN2O3
Molecular Weight: 495.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC(=O)N[C@@H](Cc2ccccc2Br)C(=O)N[C@@H](C)c2ccccc2)cc1
Standard InChI: InChI=1S/C26H27BrN2O3/c1-18(20-8-4-3-5-9-20)28-26(31)24(17-21-10-6-7-11-23(21)27)29-25(30)16-19-12-14-22(32-2)15-13-19/h3-15,18,24H,16-17H2,1-2H3,(H,28,31)(H,29,30)/t18-,24-/m0/s1
Standard InChI Key: ZFUNKFOMZPXBEZ-UUOWRZLLSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
4.8522 -8.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8511 -9.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5591 -10.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2688 -9.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2659 -8.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5573 -8.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9721 -8.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6813 -8.7985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9690 -7.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3875 -8.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0967 -8.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3844 -7.5701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0998 -9.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8029 -8.3819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5122 -8.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2183 -8.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5152 -9.6051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3937 -10.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6849 -9.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9793 -10.0247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9819 -10.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6961 -11.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3989 -10.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2152 -7.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9224 -7.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9196 -6.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2099 -5.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5014 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5076 -7.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1094 -11.2392 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
11.2045 -5.1150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4947 -4.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 1 6
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 1
11 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
13 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 30 1 0
31 32 1 0
27 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.42Molecular Weight (Monoisotopic): 494.1205AlogP: 4.61#Rotatable Bonds: 9Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.34CX Basic pKa: ┄CX LogP: 4.90CX LogD: 4.90Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.79
References 1. Granchi C, Fortunato S, Minutolo F.. (2016) Anticancer agents interacting with membrane glucose transporters., 7 (9): [PMID:28042452 ] [10.1039/C6MD00287K ]