The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-Isopropyl 6-Diazo-5-oxo-2-((((R)-1-(pivaloyloxy)ethoxy)carbonyl)amino)hexanoate ID: ALA4090102
PubChem CID: 137033596
Max Phase: Preclinical
Molecular Formula: C17H27N3O7
Molecular Weight: 385.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)O[C@H](C)OC(=O)C(C)(C)C
Standard InChI: InChI=1S/C17H27N3O7/c1-10(2)25-14(22)13(8-7-12(21)9-19-18)20-16(24)27-11(3)26-15(23)17(4,5)6/h9-11,13H,7-8H2,1-6H3,(H,20,24)/t11-,13+/m1/s1
Standard InChI Key: MFZGJESTUUDSKF-YPMHNXCESA-N
Molfile:
RDKit 2D
27 26 0 0 0 0 0 0 0 0999 V2000
11.0167 -7.6501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7312 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1601 -7.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -8.4751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7312 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1601 -4.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7312 -4.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8746 -5.1750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5792 -5.5861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3023 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5878 -7.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3023 -6.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8733 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1589 -7.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4444 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7298 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4444 -6.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0154 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7298 -8.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0125 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8746 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5891 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8746 -8.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8733 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
2 6 1 1
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 2 0
1 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
19 22 1 0
19 23 1 0
4 24 1 0
24 25 1 0
24 26 1 0
16 27 1 1
M CHG 2 11 1 12 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 385.42Molecular Weight (Monoisotopic): 385.1849AlogP: 1.62#Rotatable Bonds: 9Polar Surface Area: 144.40Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.99CX Basic pKa: ┄CX LogP: 1.23CX LogD: 1.22Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.21Np Likeness Score: 0.18
References 1. Nedelcovych MT, Tenora L, Kim BH, Kelschenbach J, Chao W, Hadas E, Jančařík A, Prchalová E, Zimmermann SC, Dash RP, Gadiano AJ, Garrett C, Furtmüller G, Oh B, Brandacher G, Alt J, Majer P, Volsky DJ, Rais R, Slusher BS.. (2017) N-(Pivaloyloxy)alkoxy-carbonyl Prodrugs of the Glutamine Antagonist 6-Diazo-5-oxo-l-norleucine (DON) as a Potential Treatment for HIV Associated Neurocognitive Disorders., 60 (16): [PMID:28759224 ] [10.1021/acs.jmedchem.7b00966 ]