The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(7-((3-Acrylamido-4-methylphenyl)amino)-1-methyl-2-oxo-1,2-dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-2-fluoro-5-methylbenzamide ID: ALA4090174
PubChem CID: 137643114
Max Phase: Preclinical
Molecular Formula: C32H30FN7O3
Molecular Weight: 579.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)c4cc(C)ccc4F)ccc2C)C3)ccc1C
Standard InChI: InChI=1S/C32H30FN7O3/c1-6-28(41)37-26-14-22(10-8-19(26)3)36-31-34-16-21-17-40(32(43)39(5)29(21)38-31)27-15-23(11-9-20(27)4)35-30(42)24-13-18(2)7-12-25(24)33/h6-16H,1,17H2,2-5H3,(H,35,42)(H,37,41)(H,34,36,38)
Standard InChI Key: NREDNKATDOVOQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
4.7568 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7557 -1.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4715 -2.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1889 -1.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1861 -0.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4698 -0.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0413 -0.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0399 -2.1755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9051 -2.1745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6200 -1.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3319 -2.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6186 -0.9372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3286 -2.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0438 -3.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0399 -1.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3284 -1.7598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3248 -3.4099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0448 -2.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6140 -2.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6226 -2.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9147 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1976 -2.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1930 -2.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9015 -3.3986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3214 -4.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7603 -3.4120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4752 -3.3941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4709 -4.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2565 -4.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2600 -5.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4594 -5.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1795 -5.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1807 -4.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4561 -6.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8942 -5.8674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6104 -5.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3211 -5.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6120 -4.6284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3108 -6.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7527 -2.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7628 -2.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0339 -0.9370 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.0452 -4.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 2 0
13 14 1 0
14 41 2 0
40 15 2 0
15 11 1 0
8 16 1 0
8 18 1 0
16 20 1 0
19 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
18 26 2 0
23 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
32 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
37 39 2 0
40 41 1 0
15 42 1 0
14 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.64Molecular Weight (Monoisotopic): 579.2394AlogP: 6.24#Rotatable Bonds: 7Polar Surface Area: 119.56Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.11CX Basic pKa: 0.70CX LogP: 6.16CX LogD: 6.16Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -1.57
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]