The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 3-[2-(2-{2,2-diphenylethylidene}hydrazinylcarbonyl)ethyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate ID: ALA4090430
PubChem CID: 137643793
Max Phase: Preclinical
Molecular Formula: C31H31N5O6
Molecular Weight: 569.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(C)NC(=O)N(CCC(=O)N/N=C/C(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C31H31N5O6/c1-3-42-30(38)28-21(2)33-31(39)35(29(28)24-15-10-16-25(19-24)36(40)41)18-17-27(37)34-32-20-26(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-16,19-20,26,29H,3,17-18H2,1-2H3,(H,33,39)(H,34,37)/b32-20+
Standard InChI Key: FBYHABBVWSVRQC-UZWMFBFFSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
11.0261 -8.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0261 -7.3081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3211 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6120 -7.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6120 -8.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3211 -8.5339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9029 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1938 -7.3081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9029 -6.0823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7352 -8.5339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3211 -6.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0261 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0261 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3211 -4.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6120 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6120 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7352 -4.4479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7352 -3.6308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4401 -4.8565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9029 -8.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7352 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4401 -7.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1492 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1492 -6.0823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8583 -7.3081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5674 -6.8995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2724 -7.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9815 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6864 -7.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6864 -8.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3955 -8.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1046 -8.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1046 -7.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3955 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9815 -6.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6864 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6864 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9815 -4.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2724 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2724 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1938 -5.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1938 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
4 7 1 0
1 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 2 0
17 19 1 0
13 17 1 0
3 11 1 0
5 20 1 0
21 22 1 0
23 24 2 0
25 26 1 0
23 25 1 0
27 28 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
28 29 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
35 40 2 0
28 35 1 0
26 27 2 0
22 23 1 0
2 21 1 0
41 42 1 0
9 41 1 0
M CHG 2 17 1 19 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.62Molecular Weight (Monoisotopic): 569.2274AlogP: 4.82#Rotatable Bonds: 11Polar Surface Area: 143.24Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.84CX Basic pKa: 1.44CX LogP: 3.89CX LogD: 3.89Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.15Np Likeness Score: -1.10
References 1. Teleb M, Zhang FX, Huang J, Gadotti VM, Farghaly AM, AboulWafa OM, Zamponi GW, Fahmy H.. (2017) Synthesis and biological evaluation of novel N3-substituted dihydropyrimidine derivatives as T-type calcium channel blockers and their efficacy as analgesics in mouse models of inflammatory pain., 25 (6): [PMID:28233679 ] [10.1016/j.bmc.2017.02.015 ]