N-Methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}benzamide

ID: ALA4090518

PubChem CID: 137644248

Max Phase: Preclinical

Molecular Formula: C26H26BF3N2O4

Molecular Weight: 498.31

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C(=O)c1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)c1ccccc1B1OC(C)(C)C(C)(C)O1

Standard InChI:  InChI=1S/C26H26BF3N2O4/c1-24(2)25(3,4)36-27(35-24)20-8-6-7-9-21(20)32(5)23(33)17-10-13-19(14-11-17)34-22-15-12-18(16-31-22)26(28,29)30/h6-16H,1-5H3

Standard InChI Key:  NUMXDFJEXKWNFA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   23.9957  -17.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2900  -17.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0003  -18.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0918  -16.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8814  -17.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6729  -17.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7522  -17.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5070  -16.6397    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.0826  -17.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8750  -16.2349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2901  -18.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4639  -18.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1675  -18.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9218  -18.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2184  -17.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6336  -18.6893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4639  -17.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6336  -17.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9218  -17.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8750  -19.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3413  -17.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9978  -18.2809    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   20.5827  -18.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5826  -19.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5827  -17.4642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1675  -17.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5097  -17.4557    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.2901  -19.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0446  -18.6893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8750  -18.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2234  -16.2349    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8750  -17.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3413  -18.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7439  -18.6102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7522  -18.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2912  -17.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
 13 12  2  0
 25 23  1  0
 32 10  2  0
 22  9  1  0
 16 14  2  0
 18 21  1  0
 32 26  1  0
 19 15  1  0
 12 35  1  0
 15  8  1  0
 23 30  2  0
 34  2  1  0
 14 19  1  0
 26 17  2  0
 35  7  2  0
 26 13  1  0
 34 22  1  0
 15 31  1  0
 23 11  1  0
 24 20  2  0
 11 22  1  0
  5  2  1  0
 28 24  1  0
  7 17  1  0
 11 28  2  0
 33 16  1  0
 32 25  1  0
 33 21  2  0
 29 33  1  0
  9  5  1  0
 20 30  1  0
 35 29  1  0
 19 18  2  0
 15 27  1  0
 25 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4090518

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.31Molecular Weight (Monoisotopic): 498.1938AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ogiyama T, Yamaguchi M, Kurikawa N, Honzumi S, Yamamoto Y, Sugiyama D, Takakusa H, Inoue SI..  (2017)  Identification of a novel hormone sensitive lipase inhibitor with a reduced potential of reactive metabolites formation.,  25  (7): [PMID:28279560] [10.1016/j.bmc.2017.02.045]

Source