6-{Methyl[4-(trifluoromethoxy)phenyl]amino}-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine-3-carboxamide

ID: ALA4090644

PubChem CID: 137644051

Max Phase: Preclinical

Molecular Formula: C26H27BF3N3O4

Molecular Weight: 513.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(c1ccc(OC(F)(F)F)cc1)c1ccc(C(=O)Nc2ccccc2B2OC(C)(C)C(C)(C)O2)cn1

Standard InChI:  InChI=1S/C26H27BF3N3O4/c1-24(2)25(3,4)37-27(36-24)20-8-6-7-9-21(20)32-23(34)17-10-15-22(31-16-17)33(5)18-11-13-19(14-12-18)35-26(28,29)30/h6-16H,1-5H3,(H,32,34)

Standard InChI Key:  WEOPPTJDPGFTCA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    9.2403  -15.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2591  -14.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8043  -13.5438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.1278  -14.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5512  -17.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1222  -14.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1103  -15.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6623  -16.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2333  -13.5454    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.5365  -16.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0221  -17.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0179  -18.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0790  -16.5272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6701  -15.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3825  -16.4529    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6889  -14.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5174  -14.7821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2368  -16.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8377  -18.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9570  -14.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6925  -13.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5183  -13.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8180  -16.4623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9478  -16.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2606  -13.9909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5140  -13.1309    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.4130  -13.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5422  -15.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9683  -15.2319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8288  -14.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7393  -16.5707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4016  -15.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8387  -17.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3056  -17.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1011  -16.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3944  -16.0603    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   11.3791  -17.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 24  2  0
 32  6  2  0
 23 35  1  0
 19 33  1  0
 22 26  1  0
 15  8  1  0
 17 22  1  0
 22  3  1  0
 33  5  1  0
 13 33  1  0
 32 36  1  0
 20  1  1  0
 28 30  2  0
 16 21  2  0
  1 18  2  0
 27 21  1  0
 35  7  2  0
 13 36  1  0
 34 11  1  0
  2 25  2  0
  7 30  1  0
 11 12  1  0
  4 27  2  0
 31 11  1  0
 10 23  2  0
 36 31  1  0
  6  4  1  0
 29 16  1  0
  1 17  1  0
  8 14  1  0
  2 29  1  0
 14 20  2  0
 35 15  1  0
  2 28  1  0
 18 24  1  0
 16 32  1  0
 28 10  1  0
 22  9  1  0
 11 33  1  0
 15 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4090644

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.33Molecular Weight (Monoisotopic): 513.2047AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ogiyama T, Yamaguchi M, Kurikawa N, Honzumi S, Yamamoto Y, Sugiyama D, Takakusa H, Inoue SI..  (2017)  Identification of a novel hormone sensitive lipase inhibitor with a reduced potential of reactive metabolites formation.,  25  (7): [PMID:28279560] [10.1016/j.bmc.2017.02.045]

Source