N2-Benzyl-6,7-dimethoxy-N2-methyl-N4-(1-methylpiperidin-4-yl)quinazoline-2,4-diamine

ID: ALA4090654

PubChem CID: 137643064

Max Phase: Preclinical

Molecular Formula: C24H31N5O2

Molecular Weight: 421.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2nc(N(C)Cc3ccccc3)nc(NC3CCN(C)CC3)c2cc1OC

Standard InChI:  InChI=1S/C24H31N5O2/c1-28-12-10-18(11-13-28)25-23-19-14-21(30-3)22(31-4)15-20(19)26-24(27-23)29(2)16-17-8-6-5-7-9-17/h5-9,14-15,18H,10-13,16H2,1-4H3,(H,25,26,27)

Standard InChI Key:  GRCRJEGHKCSKNE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    6.0862  -10.7514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0851  -11.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7931  -11.9799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7914  -10.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5000  -10.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5007  -11.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2093  -11.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9175  -11.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9128  -10.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2037  -10.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7889   -9.5253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6180  -10.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3282  -10.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6268  -11.9689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3329  -11.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0800   -9.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801   -8.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3753   -7.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6664   -8.2990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6669   -9.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3763   -9.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9590   -7.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3771  -11.9790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6697  -11.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3764  -12.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9617  -11.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2550  -11.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5475  -11.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5464  -12.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2587  -13.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9634  -12.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  4 11  1  0
  9 12  1  0
 12 13  1  0
  8 14  1  0
 14 15  1  0
 11 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
  2 23  1  0
 23 24  1  0
 23 25  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4090654

    ---

Associated Targets(Human)

EHMT1 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 (407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EHMT2 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 (93046 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.55Molecular Weight (Monoisotopic): 421.2478AlogP: 3.79#Rotatable Bonds: 7
Polar Surface Area: 62.75Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.77CX LogP: 3.72CX LogD: 2.19
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: -1.02

References

1. Xiong Y, Li F, Babault N, Wu H, Dong A, Zeng H, Chen X, Arrowsmith CH, Brown PJ, Liu J, Vedadi M, Jin J..  (2017)  Structure-activity relationship studies of G9a-like protein (GLP) inhibitors.,  25  (16): [PMID:28662962] [10.1016/j.bmc.2017.06.021]

Source