The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-Methoxyimino-5beta-cholan-24-oyl)-L-beta-homo-tryptophan ID: ALA4090681
PubChem CID: 137643073
Max Phase: Preclinical
Molecular Formula: C37H53N3O4
Molecular Weight: 603.85
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C1\CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCC(=O)N[C@H](CC(=O)O)Cc4c[nH]c5ccccc45)CC[C@@H]32)C1
Standard InChI: InChI=1S/C37H53N3O4/c1-23(9-14-34(41)39-27(21-35(42)43)19-24-22-38-33-8-6-5-7-28(24)33)30-12-13-31-29-11-10-25-20-26(40-44-4)15-17-36(25,2)32(29)16-18-37(30,31)3/h5-8,22-23,25,27,29-32,38H,9-21H2,1-4H3,(H,39,41)(H,42,43)/b40-26+/t23-,25-,27+,29+,30-,31+,32+,36+,37-/m1/s1
Standard InChI Key: ICXZJAYZTYLYEN-NXBMQGHCSA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
3.5040 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5040 -19.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2093 -19.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2093 -18.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9146 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9156 -19.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6199 -19.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3277 -19.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6178 -18.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3286 -18.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3274 -16.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6141 -17.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0381 -17.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0350 -18.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8155 -18.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3010 -17.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8205 -17.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9073 -17.6934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9114 -20.1409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.6130 -18.9151 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.3229 -17.6893 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0287 -18.9192 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0328 -16.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0759 -16.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8759 -16.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5314 -15.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4204 -16.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2204 -16.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4758 -15.7535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6053 -16.8143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.7649 -17.1390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5649 -16.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8203 -16.1959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6203 -16.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8757 -15.2527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1648 -16.6383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1094 -17.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8540 -18.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0764 -18.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0733 -19.4241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3323 -19.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8489 -19.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1750 -20.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9842 -20.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4663 -19.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1375 -19.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7969 -19.7374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0886 -19.3299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3815 -19.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
5 18 1 1
6 19 1 1
9 20 1 6
10 21 1 1
14 22 1 6
13 23 1 1
17 24 1 0
24 25 1 0
24 26 1 6
25 27 1 0
27 28 1 0
28 29 2 0
17 30 1 6
28 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
32 37 1 6
37 38 1 0
38 39 2 0
39 40 1 0
40 42 1 0
41 38 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
2 47 2 0
47 48 1 0
48 49 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.85Molecular Weight (Monoisotopic): 603.4036AlogP: 7.75#Rotatable Bonds: 10Polar Surface Area: 103.78Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.62CX Basic pKa: 3.59CX LogP: 6.66CX LogD: 4.17Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.24Np Likeness Score: 1.07
References 1. Incerti M, Russo S, Callegari D, Pala D, Giorgio C, Zanotti I, Barocelli E, Vicini P, Vacondio F, Rivara S, Castelli R, Tognolini M, Lodola A.. (2017) Metadynamics for Perspective Drug Design: Computationally Driven Synthesis of New Protein-Protein Interaction Inhibitors Targeting the EphA2 Receptor., 60 (2): [PMID:28005388 ] [10.1021/acs.jmedchem.6b01642 ]