The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(2-Fluorophenyl)-3-(1-(2-((R)-2-(2-fluorophenyl)-4-oxo-1,2-dihydroquinazolin-3(4H)-yl)ethyl)piperidin-4-yl)-2,3-dihydroquinazolin-4(1H)-one ID: ALA4090695
PubChem CID: 131633043
Max Phase: Preclinical
Molecular Formula: C35H33F2N5O2
Molecular Weight: 593.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2N[C@@H](c2ccccc2F)N1CCN1CCC(N2C(=O)c3ccccc3N[C@H]2c2ccccc2F)CC1
Standard InChI: InChI=1S/C35H33F2N5O2/c36-28-13-5-1-9-24(28)32-38-30-15-7-3-11-26(30)34(43)41(32)22-21-40-19-17-23(18-20-40)42-33(25-10-2-6-14-29(25)37)39-31-16-8-4-12-27(31)35(42)44/h1-16,23,32-33,38-39H,17-22H2/t32-,33-/m1/s1
Standard InChI Key: ZMXNWFRGUZJFLG-CZNDPXEESA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
26.2643 -23.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2631 -23.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9712 -24.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9694 -22.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6780 -23.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6768 -23.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3869 -24.4073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1027 -23.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1039 -23.1728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3893 -22.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3893 -21.9397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8126 -22.7659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8093 -24.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8018 -25.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5075 -25.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2173 -25.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2170 -24.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5107 -24.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0916 -25.6309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.5181 -23.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2247 -22.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2309 -21.9590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5244 -21.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8116 -21.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9412 -21.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6463 -21.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3566 -21.5637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0585 -21.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0710 -20.3441 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3567 -20.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7759 -20.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7652 -21.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4655 -21.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1770 -21.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1838 -20.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4829 -20.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6532 -20.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6590 -19.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9543 -19.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2435 -19.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2417 -20.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9469 -20.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3693 -19.1149 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.0523 -22.7946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
9 12 1 0
8 13 1 6
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 19 1 0
12 20 1 0
12 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 30 1 0
28 32 1 0
31 29 1 0
29 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
30 37 1 6
38 43 1 0
28 44 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.68Molecular Weight (Monoisotopic): 593.2602AlogP: 6.26#Rotatable Bonds: 6Polar Surface Area: 67.92Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.02CX Basic pKa: 7.68CX LogP: 6.69CX LogD: 6.22Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.28Np Likeness Score: -0.84
References 1. Jiang Y, Zhuang C, Chen L, Lu J, Dong G, Miao Z, Zhang W, Li J, Sheng C.. (2017) Structural Biology-Inspired Discovery of Novel KRAS-PDEδ Inhibitors., 60 (22): [PMID:28929751 ] [10.1021/acs.jmedchem.7b01243 ]