6aR,11aR-1-hydroxy-4-isoprenyl-maackiain

ID: ALA4090778

PubChem CID: 137644292

Max Phase: Preclinical

Molecular Formula: C21H20O6

Molecular Weight: 368.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCc1c(O)cc(O)c2c1OC[C@H]1c3cc4c(cc3O[C@@H]21)OCO4

Standard InChI:  InChI=1S/C21H20O6/c1-10(2)3-4-11-14(22)6-15(23)19-20(11)24-8-13-12-5-17-18(26-9-25-17)7-16(12)27-21(13)19/h3,5-7,13,21-23H,4,8-9H2,1-2H3/t13-,21+/m0/s1

Standard InChI Key:  HDSKERZFYMZNDJ-YEJXKQKISA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    3.9136   -4.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9160   -4.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6213   -5.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6186   -3.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3207   -4.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3259   -4.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7422   -4.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0275   -3.7169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7473   -4.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0347   -5.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2072   -6.1644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3562   -5.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0221   -6.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5011   -6.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1708   -5.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6487   -6.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3209   -6.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9357   -7.3662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6435   -6.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4675   -6.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2086   -3.7283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6192   -6.1731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6150   -2.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9083   -2.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046   -1.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2020   -1.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6117   -1.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4564   -4.5398    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3256   -5.7700    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
 10 11  1  0
 11 13  1  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 12  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
  1 21  1  0
  3 22  1  0
  4 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 25 27  1  0
  9 28  1  6
 10 29  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4090778

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.39Molecular Weight (Monoisotopic): 368.1260AlogP: 3.94#Rotatable Bonds: 2
Polar Surface Area: 77.38Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.84CX Basic pKa: CX LogP: 3.72CX LogD: 3.70
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.78Np Likeness Score: 2.39

References

1. Yang X, Deng S, Huang M, Wang J, Chen L, Xiong M, Yang J, Zheng S, Ma X, Zhao P, Feng Y..  (2017)  Chemical constituents from Sophora tonkinensis and their glucose transporter 4 translocation activities.,  27  (6): [PMID:28236591] [10.1016/j.bmcl.2017.01.078]

Source