2-(4-(3-methyl-4-nitro-1-phenyl-1H-pyrazol-5-yloxy)phenyl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4090789

PubChem CID: 137643275

Max Phase: Preclinical

Molecular Formula: C24H18N6O4

Molecular Weight: 454.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nn(-c2ccccc2)c(Oc2ccc(-c3nc4cc(C(N)=O)ccc4[nH]3)cc2)c1[N+](=O)[O-]

Standard InChI:  InChI=1S/C24H18N6O4/c1-14-21(30(32)33)24(29(28-14)17-5-3-2-4-6-17)34-18-10-7-15(8-11-18)23-26-19-12-9-16(22(25)31)13-20(19)27-23/h2-13H,1H3,(H2,25,31)(H,26,27)

Standard InChI Key:  BMQIGBHOMOHWQO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.6483  -16.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6471  -16.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3552  -17.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3534  -15.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0620  -16.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0668  -16.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8468  -17.2422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3242  -16.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8391  -15.9176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1394  -16.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5515  -17.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3680  -17.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7732  -16.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3560  -15.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5410  -15.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5904  -16.5576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9938  -15.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8049  -15.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9690  -14.9524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2583  -14.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6551  -15.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3571  -16.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1078  -17.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6592  -17.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4580  -17.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7023  -16.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1492  -16.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8512  -14.9337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3087  -15.5449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5931  -14.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1670  -13.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9405  -15.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9403  -14.9531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2328  -16.1790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
 18 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 28 30  1  0
 21 28  1  0
 20 31  1  0
  1 32  1  0
 32 33  2  0
 32 34  1  0
M  CHG  2  28   1  30  -1
M  END

Alternative Forms

  1. Parent:

    ALA4090789

    ---

Associated Targets(Human)

CHEK2 Tchem Serine/threonine-protein kinase Chk2 (4015 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.45Molecular Weight (Monoisotopic): 454.1390AlogP: 4.52#Rotatable Bonds: 6
Polar Surface Area: 141.96Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.07CX Basic pKa: 4.39CX LogP: 3.88CX LogD: 3.88
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -1.56

References

1. Galal SA, Abdelsamie AS, Shouman SA, Attia YM, Ali HI, Tabll A, El-Shenawy R, El Abd YS, Ali MM, Mahmoud AE, Abdel-Halim AH, Fyiad AA, Girgis AS, El-Diwani HI..  (2017)  Part I: Design, synthesis and biological evaluation of novel pyrazole-benzimidazole conjugates as checkpoint kinase 2 (Chk2) inhibitors with studying their activities alone and in combination with genotoxic drugs.,  134  [PMID:28433679] [10.1016/j.ejmech.2017.03.090]

Source