The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Deacetyl-4-methoxyl vindoline ID: ALA4090843
PubChem CID: 137644514
Max Phase: Preclinical
Molecular Formula: C24H32N2O5
Molecular Weight: 428.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(C(=O)OC)[C@@H]1OC)[C@@H]32
Standard InChI: InChI=1S/C24H32N2O5/c1-6-22-10-7-12-26-13-11-23(18(22)26)16-9-8-15(29-3)14-17(16)25(2)19(23)24(28,20(22)30-4)21(27)31-5/h7-10,14,18-20,28H,6,11-13H2,1-5H3/t18-,19+,20+,22+,23+,24-/m0/s1
Standard InChI Key: IHOZUYRKUYKMML-MCIGMTSASA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
15.7807 -8.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8141 -8.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8645 -10.3437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5143 -6.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8599 -7.3952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.3223 -7.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7067 -9.6398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5690 -9.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2259 -7.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5608 -8.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9399 -7.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2710 -11.0595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4222 -9.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6256 -7.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4448 -7.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2775 -9.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6858 -10.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2763 -7.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5353 -10.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9211 -11.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1053 -7.1692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9932 -8.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7212 -6.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5649 -10.0504 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.9821 -7.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2972 -8.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2772 -7.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7859 -9.4846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4819 -8.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5108 -10.3490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9932 -9.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6861 -7.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1434 -7.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 23 1 0
6 25 1 0
17 12 2 0
27 21 1 0
26 28 1 0
22 2 1 6
2 9 1 0
16 31 1 0
26 1 2 0
10 11 1 1
30 20 1 0
33 29 2 0
28 19 1 0
22 32 1 0
3 16 1 0
32 4 2 0
28 8 1 0
33 6 1 0
8 10 1 0
29 26 1 0
16 17 1 6
27 5 1 6
18 11 1 0
14 33 1 0
21 18 1 0
7 13 1 0
21 23 1 0
8 16 1 0
8 24 1 1
17 30 1 0
10 1 1 0
15 14 2 0
27 22 1 0
31 22 1 0
1 15 1 0
10 27 1 0
31 7 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2311AlogP: 1.72#Rotatable Bonds: 4Polar Surface Area: 71.47Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.89CX Basic pKa: 8.83CX LogP: 2.08CX LogD: 0.64Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: 2.07
References 1. Xiao C, Tian Y, Lei M, Chen F, Gan X, Yao X, Shen X, Chen J, Hu L.. (2017) Synthesis and glucose-stimulate insulin secretion (GSIS) evaluation of vindoline derivatives., 27 (5): [PMID:28162858 ] [10.1016/j.bmcl.2016.09.064 ]