4-Deacetyl-4-methoxyl vindoline

ID: ALA4090843

PubChem CID: 137644514

Max Phase: Preclinical

Molecular Formula: C24H32N2O5

Molecular Weight: 428.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@]12C=CCN3CC[C@@]4(c5ccc(OC)cc5N(C)[C@H]4[C@@](O)(C(=O)OC)[C@@H]1OC)[C@@H]32

Standard InChI:  InChI=1S/C24H32N2O5/c1-6-22-10-7-12-26-13-11-23(18(22)26)16-9-8-15(29-3)14-17(16)25(2)19(23)24(28,20(22)30-4)21(27)31-5/h7-10,14,18-20,28H,6,11-13H2,1-5H3/t18-,19+,20+,22+,23+,24-/m0/s1

Standard InChI Key:  IHOZUYRKUYKMML-MCIGMTSASA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   15.7807   -8.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8141   -8.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8645  -10.3437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5143   -6.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8599   -7.3952    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3223   -7.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7067   -9.6398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5690   -9.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2259   -7.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5608   -8.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9399   -7.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2710  -11.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4222   -9.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6256   -7.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4448   -7.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2775   -9.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6858  -10.3463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2763   -7.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5353  -10.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9211  -11.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1053   -7.1692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9932   -8.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7212   -6.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5649  -10.0504    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.9821   -7.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2972   -8.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2772   -7.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7859   -9.4846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4819   -8.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5108  -10.3490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9932   -9.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6861   -7.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1434   -7.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4 23  1  0
  6 25  1  0
 17 12  2  0
 27 21  1  0
 26 28  1  0
 22  2  1  6
  2  9  1  0
 16 31  1  0
 26  1  2  0
 10 11  1  1
 30 20  1  0
 33 29  2  0
 28 19  1  0
 22 32  1  0
  3 16  1  0
 32  4  2  0
 28  8  1  0
 33  6  1  0
  8 10  1  0
 29 26  1  0
 16 17  1  6
 27  5  1  6
 18 11  1  0
 14 33  1  0
 21 18  1  0
  7 13  1  0
 21 23  1  0
  8 16  1  0
  8 24  1  1
 17 30  1  0
 10  1  1  0
 15 14  2  0
 27 22  1  0
 31 22  1  0
  1 15  1  0
 10 27  1  0
 31  7  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4090843

    ---

Associated Targets(non-human)

MIN6 (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2311AlogP: 1.72#Rotatable Bonds: 4
Polar Surface Area: 71.47Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.89CX Basic pKa: 8.83CX LogP: 2.08CX LogD: 0.64
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: 2.07

References

1. Xiao C, Tian Y, Lei M, Chen F, Gan X, Yao X, Shen X, Chen J, Hu L..  (2017)  Synthesis and glucose-stimulate insulin secretion (GSIS) evaluation of vindoline derivatives.,  27  (5): [PMID:28162858] [10.1016/j.bmcl.2016.09.064]

Source