The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Cyclohexyl-N-((6-fluoro-1-(2-(3-methoxyphenyl)-pyridin-4-yl)-1H-indol-3-yl)methyl)methanamine ID: ALA4091128
PubChem CID: 129318960
Max Phase: Preclinical
Molecular Formula: C28H30FN3O
Molecular Weight: 443.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2cc(-n3cc(CNCC4CCCCC4)c4ccc(F)cc43)ccn2)c1
Standard InChI: InChI=1S/C28H30FN3O/c1-33-25-9-5-8-21(14-25)27-16-24(12-13-31-27)32-19-22(26-11-10-23(29)15-28(26)32)18-30-17-20-6-3-2-4-7-20/h5,8-16,19-20,30H,2-4,6-7,17-18H2,1H3
Standard InChI Key: MDKNOMUATKMYAA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
14.6990 -16.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1098 -15.6119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4435 -16.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7804 -16.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5228 -16.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0675 -17.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8740 -17.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1329 -16.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5823 -15.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1086 -14.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8252 -14.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8243 -13.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1076 -13.1357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3902 -13.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3947 -14.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2122 -17.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3911 -17.4646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9043 -18.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0832 -18.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7525 -17.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9352 -17.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4447 -17.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7818 -18.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6051 -18.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6764 -13.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6737 -12.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9569 -11.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2466 -12.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2534 -13.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9708 -13.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9532 -11.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6668 -10.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9406 -16.3690 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 1 0
3 1 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
1 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
14 25 1 0
27 31 1 0
31 32 1 0
8 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.57Molecular Weight (Monoisotopic): 443.2373AlogP: 6.51#Rotatable Bonds: 7Polar Surface Area: 39.08Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.91CX LogP: 6.43CX LogD: 3.87Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -1.12
References 1. Yamada K, Levell J, Yoon T, Kohls D, Yowe D, Rigel DF, Imase H, Yuan J, Yasoshima K, DiPetrillo K, Monovich L, Xu L, Zhu M, Kato M, Jain M, Idamakanti N, Taslimi P, Kawanami T, Argikar UA, Kunjathoor V, Xie X, Yagi YI, Iwaki Y, Robinson Z, Park HM.. (2017) Optimization of Allosteric With-No-Lysine (WNK) Kinase Inhibitors and Efficacy in Rodent Hypertension Models., 60 (16): [PMID:28771350 ] [10.1021/acs.jmedchem.7b00708 ]