2-(2-chloro-6-fluorobenzylthio)-7-(4-chloro-3-methoxyphenyl)-1-(4-fluoro-3-methylphenyl)-4,5,6,7-tetrahydro-1H-benzo[d]imidazole

ID: ALA4091129

PubChem CID: 118464755

Max Phase: Preclinical

Molecular Formula: C28H24Cl2F2N2OS

Molecular Weight: 545.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C2CCCc3nc(SCc4c(F)cccc4Cl)n(-c4ccc(F)c(C)c4)c32)ccc1Cl

Standard InChI:  InChI=1S/C28H24Cl2F2N2OS/c1-16-13-18(10-12-23(16)31)34-27-19(17-9-11-22(30)26(14-17)35-2)5-3-8-25(27)33-28(34)36-15-20-21(29)6-4-7-24(20)32/h4,6-7,9-14,19H,3,5,8,15H2,1-2H3

Standard InChI Key:  QVNOKSZKIRNRIF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   11.7251   -9.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2480   -9.6830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4696   -9.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4658   -8.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2460   -8.3606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7590   -8.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0518   -8.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0556   -9.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7643   -9.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5022  -10.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3013  -10.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5555  -11.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0105  -12.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2113  -11.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9571  -11.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3588  -11.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2687  -12.7872    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7643  -10.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0590  -11.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0647  -11.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7716  -12.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4769  -11.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4731  -11.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3556  -12.2978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3556  -13.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7716  -13.1084    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.5423   -9.0178    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.9509   -8.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7681   -8.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1767   -9.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9971   -9.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4024   -8.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9906   -7.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1734   -7.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7648   -6.8928    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.7681   -9.7228    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  1  5  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  3  9  1  0
  4  6  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 12 16  1  0
 13 17  1  0
  2 10  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  1  0
 20 24  1  0
 21 26  1  0
  9 18  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  2  0
 27 28  1  0
 34 35  1  0
 30 36  1  0
  1 27  1  0
M  END

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpbar1 G-protein coupled bile acid receptor 1 (577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.48Molecular Weight (Monoisotopic): 544.0954AlogP: 8.53#Rotatable Bonds: 6
Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.35CX LogP: 9.11CX LogD: 9.11
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.60

References

1. Zhang X, Wall M, Sui Z, Kauffman J, Hou C, Chen C, Du F, Kirchner T, Liang Y, Johnson DL, Murray WV, Demarest K..  (2017)  Discovery of Orally Efficacious Tetrahydrobenzimidazoles as TGR5 Agonists for Type 2 Diabetes.,  (5): [PMID:28523111] [10.1021/acsmedchemlett.7b00116]

Source