(S)-4-benzyl-1-(4-((S)-2-(4-fluorobenzyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione

ID: ALA4091239

PubChem CID: 137642611

Max Phase: Preclinical

Molecular Formula: C32H37FN4S

Molecular Weight: 528.74

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc(CC2=N[C@@H](CCCCN3C[C@H](Cc4ccccc4)N(CCc4ccccc4)C3=S)CN2)cc1

Standard InChI:  InChI=1S/C32H37FN4S/c33-28-16-14-27(15-17-28)22-31-34-23-29(35-31)13-7-8-19-36-24-30(21-26-11-5-2-6-12-26)37(32(36)38)20-18-25-9-3-1-4-10-25/h1-6,9-12,14-17,29-30H,7-8,13,18-24H2,(H,34,35)/t29-,30-/m0/s1

Standard InChI Key:  ILDOXTACGLKNNB-KYJUHHDHSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   14.3846  -18.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5529  -19.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3296  -19.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4980  -20.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2747  -20.8489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5243  -21.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3415  -21.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5956  -20.8510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9353  -20.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9363  -19.5523    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.8206  -22.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4248  -23.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6107  -23.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2151  -23.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6366  -24.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4579  -24.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8497  -23.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3732  -20.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9795  -21.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7412  -20.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3766  -21.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1378  -21.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2629  -20.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6207  -19.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8621  -20.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6078  -18.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3555  -17.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5383  -17.7130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2843  -18.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9445  -18.9713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5066  -18.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3352  -19.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5566  -19.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3851  -20.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9917  -21.1335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7726  -20.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9404  -20.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8214  -21.9327    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  7 11  1  1
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  8 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 26  1  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091239

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.74Molecular Weight (Monoisotopic): 528.2723AlogP: 5.67#Rotatable Bonds: 12
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.86CX LogP: 6.59CX LogD: 4.45
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.41

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source