N-(2-(4-Ethylphenylamino)benzo[d]oxazol-5-yl)-4-heptylbenzamide

ID: ALA4091259

PubChem CID: 54765796

Max Phase: Preclinical

Molecular Formula: C29H33N3O2

Molecular Weight: 455.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCc1ccc(C(=O)Nc2ccc3oc(Nc4ccc(CC)cc4)nc3c2)cc1

Standard InChI:  InChI=1S/C29H33N3O2/c1-3-5-6-7-8-9-22-10-14-23(15-11-22)28(33)30-25-18-19-27-26(20-25)32-29(34-27)31-24-16-12-21(4-2)13-17-24/h10-20H,3-9H2,1-2H3,(H,30,33)(H,31,32)

Standard InChI Key:  NTOXITXDHGVLGZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   18.1171  -28.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1160  -29.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8240  -30.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8222  -28.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5308  -28.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5356  -29.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3157  -30.0366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7930  -29.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3079  -28.7121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6102  -29.3666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0146  -28.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8317  -28.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2361  -27.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8232  -27.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0019  -27.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6012  -27.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2267  -26.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8130  -25.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4093  -28.5647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4091  -27.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7013  -27.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1167  -27.3387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7064  -26.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9994  -26.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2908  -26.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2937  -27.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0012  -27.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5825  -26.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5812  -25.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8729  -24.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8716  -24.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1632  -23.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1619  -22.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4536  -22.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Associated Targets(Human)

IL6 Tclin Interleukin-6 (43 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.60Molecular Weight (Monoisotopic): 455.2573AlogP: 7.90#Rotatable Bonds: 11
Polar Surface Area: 67.16Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.30CX Basic pKa: CX LogP: 8.67CX LogD: 8.67
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: -1.04

References

1. Kim D, Won HY, Hwang ES, Kim YK, Choo HP..  (2017)  Synthesis of benzoxazole derivatives as interleukin-6 antagonists.,  25  (12): [PMID:28442260] [10.1016/j.bmc.2017.03.072]

Source