The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(2-(Isopropylsulfonyl)phenyl)-N2-(2-methoxy-4-morpholinophenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine ID: ALA4091309
PubChem CID: 121320420
Max Phase: Preclinical
Molecular Formula: C26H30N6O4S
Molecular Weight: 522.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCOCC2)ccc1Nc1nc(Nc2ccccc2S(=O)(=O)C(C)C)c2cc[nH]c2n1
Standard InChI: InChI=1S/C26H30N6O4S/c1-17(2)37(33,34)23-7-5-4-6-21(23)28-25-19-10-11-27-24(19)30-26(31-25)29-20-9-8-18(16-22(20)35-3)32-12-14-36-15-13-32/h4-11,16-17H,12-15H2,1-3H3,(H3,27,28,29,30,31)
Standard InChI Key: XPJPOQUSXHXZIK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
13.6791 -8.2737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0919 -8.9825 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.5003 -8.2712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8291 -11.4534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1218 -11.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4107 -11.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4146 -10.6275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1239 -10.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8346 -10.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5418 -11.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2512 -11.4605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9582 -11.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9564 -12.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2491 -13.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5343 -12.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6640 -13.0964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3755 -12.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0911 -13.0964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7943 -12.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7943 -11.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0911 -11.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3755 -11.8674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5686 -12.9353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5686 -11.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0475 -12.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0911 -10.6369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3762 -10.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3762 -9.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6730 -8.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9615 -9.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9615 -10.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6730 -10.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8117 -9.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8228 -10.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5121 -8.9763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2478 -13.9179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5395 -14.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
24 25 2 0
23 25 1 0
19 23 1 0
20 24 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
33 34 1 0
33 35 1 0
2 33 1 0
28 2 1 0
26 27 1 0
21 26 1 0
16 17 1 0
13 16 1 0
4 10 1 0
14 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.63Molecular Weight (Monoisotopic): 522.2049AlogP: 4.47#Rotatable Bonds: 8Polar Surface Area: 121.47Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.82CX Basic pKa: 5.74CX LogP: 4.32CX LogD: 4.32Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.59
References 1. Sugimoto Y, Sawant DB, Fisk HA, Mao L, Li C, Chettiar S, Li PK, Darby MV, Brueggemeier RW.. (2017) Novel pyrrolopyrimidines as Mps1/TTK kinase inhibitors for breast cancer., 25 (7): [PMID:28259529 ] [10.1016/j.bmc.2017.02.030 ]