The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Digoxigenin (3R)-N-methoxy-2,6-dideoxy-3-O-methyl-beta-D-glucopyranoside ID: ALA4091319
PubChem CID: 137654852
Max Phase: Preclinical
Molecular Formula: C31H49NO8
Molecular Weight: 563.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1C[C@H](N(OC)[C@@H]2CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3C[C@@H](O)[C@]3(C)[C@@H](C5=CC(=O)OC5)CC[C@]43O)C2)O[C@H](C)[C@H]1O
Standard InChI: InChI=1S/C31H49NO8/c1-17-28(35)24(37-4)15-26(40-17)32(38-5)20-8-10-29(2)19(13-20)6-7-22-23(29)14-25(33)30(3)21(9-11-31(22,30)36)18-12-27(34)39-16-18/h12,17,19-26,28,33,35-36H,6-11,13-16H2,1-5H3/t17-,19-,20-,21-,22-,23+,24-,25-,26-,28-,29+,30+,31+/m1/s1
Standard InChI Key: LSZKNMIUSAAYDH-QJSBGWEOSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
22.0765 -20.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6568 -20.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1197 -21.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0702 -20.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3667 -20.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8131 -21.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7884 -20.7269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0765 -19.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3667 -19.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4016 -21.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3768 -20.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6568 -21.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9469 -21.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0455 -19.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5313 -21.9280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2411 -21.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0765 -21.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9469 -20.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3667 -21.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2411 -20.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7082 -22.0105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6587 -20.3761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0765 -19.8809 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.6568 -19.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6485 -22.3407 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.3667 -21.1066 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.8090 -22.3572 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.7823 -19.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7868 -20.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5693 -20.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0484 -19.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5620 -19.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8102 -18.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5859 -18.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5814 -17.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8028 -17.1101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3262 -17.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7782 -18.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7823 -21.1025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0776 -18.2424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2399 -16.8743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5441 -22.7451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2581 -23.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7333 -22.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 29 1 0
2 5 1 0
3 6 1 0
4 7 1 0
5 9 1 0
6 15 1 0
7 6 1 0
8 28 1 0
9 8 1 0
10 3 1 0
11 4 1 0
12 2 1 0
13 12 1 0
4 14 1 1
16 15 1 6
16 13 1 0
17 1 1 0
18 2 1 0
19 17 1 0
20 18 1 0
10 21 1 1
11 22 1 6
1 23 1 1
2 24 1 1
12 25 1 1
5 26 1 6
6 27 1 6
5 1 1 0
19 12 1 0
20 16 1 0
11 10 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
33 34 2 0
34 35 1 0
35 36 1 0
36 37 1 0
37 33 1 0
32 33 1 1
28 38 1 1
29 39 1 1
8 40 1 1
35 41 2 0
15 42 1 0
42 43 1 0
21 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.73Molecular Weight (Monoisotopic): 563.3458AlogP: 2.96#Rotatable Bonds: 5Polar Surface Area: 117.92Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.85CX Basic pKa: 0.21CX LogP: 2.34CX LogD: 2.33Aromatic Rings: ┄Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: 2.58
References 1. Wang DD, Li XS, Bao YZ, Liu J, Zhang XK, Yao XS, Sun XL, Tang JS.. (2017) Synthesis of MeON-neoglycosides of digoxigenin with 6-deoxy- and 2,6-dideoxy-d-glucose derivatives and their anticancer activity., 27 (15): [PMID:28633895 ] [10.1016/j.bmcl.2017.06.008 ] 2. Zhan, Yanyan Y and 22 more authors. 2008-09 Cytosporone B is an agonist for nuclear orphan receptor Nur77. [PMID:18690216 ]