(E)-3-(3-((((6-bromoquinolin-2-yl)methyl)(hexyl)amino)methyl)phenyl)-N-hydroxyacrylamide

ID: ALA4091336

PubChem CID: 137655543

Max Phase: Preclinical

Molecular Formula: C26H30BrN3O2

Molecular Weight: 496.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCN(Cc1cccc(/C=C/C(=O)NO)c1)Cc1ccc2cc(Br)ccc2n1

Standard InChI:  InChI=1S/C26H30BrN3O2/c1-2-3-4-5-15-30(18-21-8-6-7-20(16-21)9-14-26(31)29-32)19-24-12-10-22-17-23(27)11-13-25(22)28-24/h6-14,16-17,32H,2-5,15,18-19H2,1H3,(H,29,31)/b14-9+

Standard InChI Key:  QDRGUXZIUCUNNY-NTEUORMPSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   14.2293  -16.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2281  -17.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9362  -17.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9344  -15.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6430  -16.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6438  -17.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3523  -17.5291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0606  -17.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0558  -16.2962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3467  -15.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7698  -17.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4760  -17.1128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1853  -17.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8914  -17.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5956  -17.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3012  -17.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2985  -16.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5842  -15.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8815  -16.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4693  -17.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1737  -18.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5215  -15.8982    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   19.8847  -17.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5891  -18.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3001  -17.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0045  -18.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0103  -17.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7166  -17.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4257  -17.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1320  -17.0957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4285  -18.3239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8411  -17.5019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 12 20  1  0
 20 21  1  0
  1 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 16 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091336

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (HDAC1 and HDAC2) (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.45Molecular Weight (Monoisotopic): 495.1521AlogP: 6.10#Rotatable Bonds: 11
Polar Surface Area: 65.46Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.59CX Basic pKa: 8.46CX LogP: 5.99CX LogD: 5.08
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.15Np Likeness Score: -0.76

References

1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H..  (2017)  Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors.,  133  [PMID:28371677] [10.1016/j.ejmech.2017.03.064]

Source