2-(5-(3-Hydroxyphenyl)pent-4-ynamido)cyclohex-1-ene-1-carboxylic acid

ID: ALA4091501

PubChem CID: 137655320

Max Phase: Preclinical

Molecular Formula: C18H19NO4

Molecular Weight: 313.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCC#Cc1cccc(O)c1)NC1=C(C(=O)O)CCCC1

Standard InChI:  InChI=1S/C18H19NO4/c20-14-8-5-7-13(12-14)6-1-4-11-17(21)19-16-10-3-2-9-15(16)18(22)23/h5,7-8,12,20H,2-4,9-11H2,(H,19,21)(H,22,23)

Standard InChI Key:  JRSOXQYMKPJHLL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    2.4254  -14.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4242  -15.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1323  -16.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8420  -15.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8391  -14.7966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1305  -14.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5431  -14.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2492  -13.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9554  -13.5616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6646  -13.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3708  -13.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0800  -13.9622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3677  -12.7391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7862  -13.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4922  -13.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1962  -13.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1974  -12.7363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4883  -12.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7781  -12.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4914  -14.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7833  -15.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1987  -15.1881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7176  -14.3918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  3  0
  5  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  2  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 15 20  1  0
 20 21  2  0
 20 22  1  0
  1 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091501

    ---

Associated Targets(Human)

HCAR2 Tclin Hydroxycarboxylic acid receptor 2 (1903 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 313.35Molecular Weight (Monoisotopic): 313.1314AlogP: 2.55#Rotatable Bonds: 4
Polar Surface Area: 86.63Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.11CX Basic pKa: CX LogP: 2.54CX LogD: -0.92
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.75Np Likeness Score: 0.04

References

1. Bobileva O, Ikaunieks M, Duburs G, Mandrika I, Petrovska R, Klovins J, Loza E..  (2017)  Synthesis and evaluation of (E)-2-(5-phenylpent-2-en-4-ynamido)cyclohex-1-ene-1-carboxylate derivatives as HCA2 receptor agonists.,  25  (16): [PMID:28668361] [10.1016/j.bmc.2017.06.028]

Source