(3-Chlorophenyl)(6-isopropoxy-1-((4-isopropoxyphenoxy)methyl)-3,4-dihydroisoquinolin-2(1H)-yl)methanethione

ID: ALA4091770

PubChem CID: 137656010

Max Phase: Preclinical

Molecular Formula: C29H32ClNO3S

Molecular Weight: 510.10

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Oc1ccc(OCC2c3ccc(OC(C)C)cc3CCN2C(=S)c2cccc(Cl)c2)cc1

Standard InChI:  InChI=1S/C29H32ClNO3S/c1-19(2)33-25-10-8-24(9-11-25)32-18-28-27-13-12-26(34-20(3)4)17-21(27)14-15-31(28)29(35)22-6-5-7-23(30)16-22/h5-13,16-17,19-20,28H,14-15,18H2,1-4H3

Standard InChI Key:  NPEZDULFGPLXGJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   34.5724  -13.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5712  -14.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2793  -14.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2775  -13.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9861  -13.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9850  -14.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6911  -14.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4030  -14.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4042  -13.4449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6935  -13.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1129  -13.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8196  -13.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1149  -12.2208    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.8160  -14.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5219  -14.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2315  -14.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2309  -13.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5244  -13.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6935  -12.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9858  -11.8055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9858  -10.9883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6947  -10.5828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6950   -9.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9868   -9.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2767   -9.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2799  -10.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8632  -14.6740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1558  -14.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9382  -13.0373    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   33.1565  -13.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4478  -14.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9857   -8.5397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6929   -8.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4011   -8.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6918   -7.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 12  1  0
 10 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  2 27  1  0
 27 28  1  0
 17 29  1  0
 28 30  1  0
 28 31  1  0
 24 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091770

    ---

Associated Targets(non-human)

Grin1 Glutamate NMDA receptor; Grin1/Grin2b (1028 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grin1 Glutamate NMDA receptor; Grin1/Grin2c (1127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grin1 Ionotropic glutamate receptor NMDA 1/2D (870 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.10Molecular Weight (Monoisotopic): 509.1791AlogP: 7.27#Rotatable Bonds: 8
Polar Surface Area: 30.93Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 7.46CX LogD: 7.46
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.83

References

1. Strong KL, Epplin MP, Bacsa J, Butch CJ, Burger PB, Menaldino DS, Traynelis SF, Liotta DC..  (2017)  The Structure-Activity Relationship of a Tetrahydroisoquinoline Class of N-Methyl-d-Aspartate Receptor Modulators that Potentiates GluN2B-Containing N-Methyl-d-Aspartate Receptors.,  60  (13): [PMID:28586221] [10.1021/acs.jmedchem.7b00239]

Source