The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3,5-Bis(4-pentafluorothiobenzylidene)-tetrahydrothiopyran-4-one ID: ALA4091786
PubChem CID: 137652961
Max Phase: Preclinical
Molecular Formula: C19H14F10OS3
Molecular Weight: 544.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2ccc(S(F)(F)(F)(F)F)cc2)CSC/C1=C\c1ccc(S(F)(F)(F)(F)F)cc1
Standard InChI: InChI=1S/C19H14F10OS3/c20-32(21,22,23,24)17-5-1-13(2-6-17)9-15-11-31-12-16(19(15)30)10-14-3-7-18(8-4-14)33(25,26,27,28)29/h1-10H,11-12H2/b15-9+,16-10+
Standard InChI Key: VPIODVANGKMJSC-KAVGSWPWSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
36.1834 -2.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1834 -2.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8887 -3.3802 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.5940 -2.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5940 -2.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8887 -1.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3029 -1.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0094 -2.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8887 -0.9286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4745 -1.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7680 -2.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0597 -1.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3536 -2.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3556 -2.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0695 -3.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7726 -2.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0054 -2.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7111 -3.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4210 -2.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4207 -2.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7145 -1.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6496 -3.3927 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.9402 -2.9871 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6531 -4.2099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.9365 -3.7971 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6423 -2.5754 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.2242 -3.9704 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.1280 -3.3947 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.1267 -4.2119 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.8364 -2.9872 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.8336 -3.8012 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.1237 -2.5754 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.5459 -3.9704 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
7 8 1 0
6 9 2 0
1 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
8 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 8 1 0
14 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
22 26 1 0
22 27 1 0
19 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
28 32 1 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.50Molecular Weight (Monoisotopic): 544.0047AlogP: 9.78#Rotatable Bonds: 4Polar Surface Area: 17.07Molecular Species: ┄HBA: 2HBD: ┄#RO5 Violations: 2HBA (Lipinski): 1HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.25CX LogD: 9.25Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -0.20
References 1. Schmitt F, Gold M, Begemann G, Andronache I, Biersack B, Schobert R.. (2017) Fluoro and pentafluorothio analogs of the antitumoral curcuminoid EF24 with superior antiangiogenic and vascular-disruptive effects., 25 (17): [PMID:28774574 ] [10.1016/j.bmc.2017.07.039 ]