2-(Benzo[d]isoxazol-3-yl)-N-(3-chloro-5-(trifluoromethyl)phenyl)-2-oxoacetohydrazonoyl cyanide

ID: ALA4091792

PubChem CID: 137653440

Max Phase: Preclinical

Molecular Formula: C17H8ClF3N4O2

Molecular Weight: 392.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C/C(=N\Nc1cc(Cl)cc(C(F)(F)F)c1)C(=O)c1noc2ccccc12

Standard InChI:  InChI=1S/C17H8ClF3N4O2/c18-10-5-9(17(19,20)21)6-11(7-10)23-24-13(8-22)16(26)15-12-3-1-2-4-14(12)27-25-15/h1-7,23H/b24-13+

Standard InChI Key:  IRGZNIOJFWHNLH-ZMOGYAJESA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   35.7115  -25.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7103  -26.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4225  -27.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1363  -26.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1335  -25.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4207  -25.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4183  -24.7135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1289  -24.3028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1265  -23.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8371  -23.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8346  -22.2454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5501  -23.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8455  -23.7466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2927  -23.1410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4102  -23.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6972  -22.6675    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9982  -27.1795    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.4390  -24.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6366  -24.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0883  -24.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3411  -25.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1474  -25.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6922  -25.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8488  -27.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8501  -27.9998    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5600  -26.7688    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5566  -27.5905    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 19  1  0
 18 13  1  0
 13 14  1  0
 14 12  2  0
 15 16  3  0
  9 15  1  0
  2 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  4 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091792

    ---

Associated Targets(Human)

RAPGEF3 Tchem Rap guanine nucleotide exchange factor 3 (15528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rapgef4 Rap guanine nucleotide exchange factor 4 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.72Molecular Weight (Monoisotopic): 392.0288AlogP: 4.67#Rotatable Bonds: 4
Polar Surface Area: 91.28Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.39CX Basic pKa: CX LogP: 5.37CX LogD: 3.65
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.40Np Likeness Score: -1.71

References

1. Ye N, Zhu Y, Liu Z, Mei FC, Chen H, Wang P, Cheng X, Zhou J..  (2017)  Identification of novel 2-(benzo[d]isoxazol-3-yl)-2-oxo-N-phenylacetohydrazonoyl cyanide analoguesas potent EPAC antagonists.,  134  [PMID:28399451] [10.1016/j.ejmech.2017.04.001]

Source