The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S,7S)-17-Benzyl-4-isobutyl-2,5,10-trioxo-1-oxa-3,6,11-triazacycloheptadecane-7-carbaldehyde ID: ALA4091852
PubChem CID: 137656252
Max Phase: Preclinical
Molecular Formula: C25H37N3O5
Molecular Weight: 459.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H]1NC(=O)OC(Cc2ccccc2)CCCCCNC(=O)CC[C@@H](C=O)NC1=O
Standard InChI: InChI=1S/C25H37N3O5/c1-18(2)15-22-24(31)27-20(17-29)12-13-23(30)26-14-8-4-7-11-21(33-25(32)28-22)16-19-9-5-3-6-10-19/h3,5-6,9-10,17-18,20-22H,4,7-8,11-16H2,1-2H3,(H,26,30)(H,27,31)(H,28,32)/t20-,21?,22-/m0/s1
Standard InChI Key: VAUXXFOKPJQVFM-NHNZYLEHSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
11.6770 -8.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1208 -7.0135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4660 -9.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9841 -8.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8652 -8.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0793 -6.1267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1681 -8.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7666 -4.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5761 -8.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2691 -8.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4660 -8.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1485 -7.2354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7308 -6.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0378 -5.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3920 -8.2146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4099 -7.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0557 -4.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7128 -6.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3678 -6.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3482 -5.9171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6066 -7.2694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1093 -5.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0897 -4.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9355 -5.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9360 -6.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8509 -4.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8313 -3.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6316 -4.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7623 -9.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7619 -10.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4662 -10.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1723 -10.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1692 -9.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
15 1 1 0
14 17 1 6
14 13 1 0
18 16 1 0
13 18 1 0
16 2 2 0
11 3 1 0
16 15 1 0
5 7 1 0
6 14 1 0
7 11 1 0
17 8 2 0
12 7 1 0
4 10 1 0
9 5 1 0
10 9 1 0
12 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 1
22 24 1 0
24 6 1 0
24 25 2 0
23 26 1 0
26 27 1 0
26 28 1 0
3 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 3 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.59Molecular Weight (Monoisotopic): 459.2733AlogP: 2.89#Rotatable Bonds: 5Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.62CX Basic pKa: ┄CX LogP: 2.85CX LogD: 2.85Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: 0.66
References 1. Damalanka VC, Kim Y, Galasiti Kankanamalage AC, Lushington GH, Mehzabeen N, Battaile KP, Lovell S, Chang KO, Groutas WC.. (2017) Design, synthesis, and evaluation of a novel series of macrocyclic inhibitors of norovirus 3CL protease., 127 [PMID:28038326 ] [10.1016/j.ejmech.2016.12.033 ]