7-(4-chloro-3-methoxyphenyl)-2-(2-chloro-6-fluorobenzylthio)-7-(fluoromethyl)-1-(4-fluorophenyl)-4, 5, 6, 7-tetrahydro-1H-benzo[d]imidazole

ID: ALA4091882

PubChem CID: 118464749

Max Phase: Preclinical

Molecular Formula: C28H23Cl2F3N2OS

Molecular Weight: 563.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C2(CF)CCCc3nc(SCc4c(F)cccc4Cl)n(-c4ccc(F)cc4)c32)ccc1Cl

Standard InChI:  InChI=1S/C28H23Cl2F3N2OS/c1-36-25-14-17(7-12-22(25)30)28(16-31)13-3-6-24-26(28)35(19-10-8-18(32)9-11-19)27(34-24)37-15-20-21(29)4-2-5-23(20)33/h2,4-5,7-12,14H,3,6,13,15-16H2,1H3

Standard InChI Key:  OOCNXIMGJUAVSX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    8.5269   -7.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7415   -6.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9515   -7.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1128   -7.4873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8591   -7.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7722   -6.3419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9708   -6.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5651   -6.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5651   -5.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7433   -5.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3335   -6.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9436   -8.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1630   -8.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9968   -9.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6076   -9.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3841   -9.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5503   -8.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4343  -10.6935    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.5682   -7.5658    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.2773   -7.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9864   -7.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9865   -8.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6950   -8.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4057   -8.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4057   -7.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6941   -7.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6941   -6.3388    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.2775   -8.7963    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.1024   -8.2485    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.3804   -6.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5910   -6.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3758   -7.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9560   -8.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7431   -7.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0194   -6.1359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2291   -6.3439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5858   -7.7115    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  4  8  1  0
  9 10  1  0
 10 11  1  0
 11  2  1  0
  8  2  1  0
  7  9  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 15 18  1  0
  4 12  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 26 27  1  0
 22 28  1  0
 20 21  1  0
 19 20  1  0
  5 19  1  0
  1 29  1  0
  3 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34  3  1  0
 35 36  1  0
 31 35  1  0
 32 37  1  0
M  END

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpbar1 G-protein coupled bile acid receptor 1 (577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 563.47Molecular Weight (Monoisotopic): 562.0860AlogP: 8.35#Rotatable Bonds: 7
Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.07CX LogP: 8.58CX LogD: 8.58
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -1.39

References

1. Zhang X, Wall M, Sui Z, Kauffman J, Hou C, Chen C, Du F, Kirchner T, Liang Y, Johnson DL, Murray WV, Demarest K..  (2017)  Discovery of Orally Efficacious Tetrahydrobenzimidazoles as TGR5 Agonists for Type 2 Diabetes.,  (5): [PMID:28523111] [10.1021/acsmedchemlett.7b00116]

Source