(S)-4-benzyl-1-(4-((S)-2-(3-methylbenzyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione

ID: ALA4091903

PubChem CID: 137654410

Max Phase: Preclinical

Molecular Formula: C33H40N4S

Molecular Weight: 524.78

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(CC2=N[C@@H](CCCCN3C[C@H](Cc4ccccc4)N(CCc4ccccc4)C3=S)CN2)c1

Standard InChI:  InChI=1S/C33H40N4S/c1-26-11-10-16-29(21-26)23-32-34-24-30(35-32)17-8-9-19-36-25-31(22-28-14-6-3-7-15-28)37(33(36)38)20-18-27-12-4-2-5-13-27/h2-7,10-16,21,30-31H,8-9,17-20,22-25H2,1H3,(H,34,35)/t30-,31-/m0/s1

Standard InChI Key:  QLPBXLUVFUQXLE-CONSDPRKSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   11.3576   -4.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1740   -4.4208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3932   -3.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7093   -3.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0728   -3.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9620   -5.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1587   -3.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7892   -3.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5547   -3.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1852   -4.1010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9506   -3.8149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6307   -4.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2703   -3.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9842   -2.9924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1678   -3.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6587   -2.3889    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.0577   -3.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1948   -4.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5652   -5.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7017   -6.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4685   -6.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0993   -5.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9596   -5.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4352   -2.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2509   -2.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6615   -1.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4778   -1.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8883   -0.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4816   -0.2427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6602   -0.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2534   -0.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3833   -5.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9860   -6.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4066   -7.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2246   -7.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6201   -6.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1971   -5.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0106   -7.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  3  7  1  6
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 13 17  1  1
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  6 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 34 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091903

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.78Molecular Weight (Monoisotopic): 524.2974AlogP: 5.83#Rotatable Bonds: 12
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.86CX LogP: 6.96CX LogD: 4.82
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.31

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source