The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(6-(3-(Pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenyl)benzamide ID: ALA4091970
PubChem CID: 137653682
Max Phase: Preclinical
Molecular Formula: C27H27N3O3
Molecular Weight: 441.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(-c2nc3ccc(OCCCN4CCCC4)cc3o2)c1)c1ccccc1
Standard InChI: InChI=1S/C27H27N3O3/c31-26(20-8-2-1-3-9-20)28-22-11-6-10-21(18-22)27-29-24-13-12-23(19-25(24)33-27)32-17-7-16-30-14-4-5-15-30/h1-3,6,8-13,18-19H,4-5,7,14-17H2,(H,28,31)
Standard InChI Key: JHCQRKZKHTWQQT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
15.3419 -16.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7505 -15.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3419 -14.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7505 -14.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5718 -14.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9804 -14.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5718 -15.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7505 -17.1090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5206 -16.3983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1120 -15.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2907 -15.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8821 -14.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2907 -14.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1120 -14.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5206 -14.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5806 -15.6427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0608 -14.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5806 -14.3195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7993 -14.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7993 -15.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0902 -15.8024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3811 -15.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3811 -14.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0902 -14.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6679 -15.8024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9588 -15.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2497 -15.8024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5406 -15.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8274 -15.8024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7434 -16.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9408 -16.7858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5281 -16.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0801 -15.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
16 20 1 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
20 21 2 0
26 27 1 0
27 28 1 0
25 26 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
29 33 1 0
28 29 1 0
22 25 1 0
12 17 1 0
9 10 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.2052AlogP: 5.61#Rotatable Bonds: 8Polar Surface Area: 67.60Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.27CX LogP: 4.76CX LogD: 2.90Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.71
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]