N-(3-(6-(3-(Pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenyl)benzamide

ID: ALA4091970

PubChem CID: 137653682

Max Phase: Preclinical

Molecular Formula: C27H27N3O3

Molecular Weight: 441.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(-c2nc3ccc(OCCCN4CCCC4)cc3o2)c1)c1ccccc1

Standard InChI:  InChI=1S/C27H27N3O3/c31-26(20-8-2-1-3-9-20)28-22-11-6-10-21(18-22)27-29-24-13-12-23(19-25(24)33-27)32-17-7-16-30-14-4-5-15-30/h1-3,6,8-13,18-19H,4-5,7,14-17H2,(H,28,31)

Standard InChI Key:  JHCQRKZKHTWQQT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   15.3419  -16.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7505  -15.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3419  -14.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7505  -14.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5718  -14.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9804  -14.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5718  -15.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7505  -17.1090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5206  -16.3983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1120  -15.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2907  -15.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8821  -14.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2907  -14.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1120  -14.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5206  -14.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5806  -15.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0608  -14.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5806  -14.3195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7993  -14.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7993  -15.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0902  -15.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3811  -15.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3811  -14.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0902  -14.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6679  -15.8024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9588  -15.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2497  -15.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5406  -15.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8274  -15.8024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7434  -16.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9408  -16.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5281  -16.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0801  -15.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 16 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
 20 21  2  0
 26 27  1  0
 27 28  1  0
 25 26  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 29 33  1  0
 28 29  1  0
 22 25  1  0
 12 17  1  0
  9 10  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4091970

    ---

Associated Targets(Human)

TLR9 Tclin Toll-like receptor 9 (943 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.2052AlogP: 5.61#Rotatable Bonds: 8
Polar Surface Area: 67.60Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.27CX LogP: 4.76CX LogD: 2.90
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.71

References

1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A..  (2017)  Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism.,  134  [PMID:28437629] [10.1016/j.ejmech.2017.03.086]

Source