The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(2-Bromo-5-((2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl)phenyl)pyrrolidine-3-carboxamide 2,2,2-trifluoroacetate ID: ALA4091988
PubChem CID: 137654655
Max Phase: Preclinical
Molecular Formula: C22H20BrF3N4O5
Molecular Weight: 443.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(Cn2c(=O)[nH]c(=O)c3ccccc32)ccc1Br)[C@H]1CCNC1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C20H19BrN4O3.C2HF3O2/c21-15-6-5-12(9-16(15)23-18(26)13-7-8-22-10-13)11-25-17-4-2-1-3-14(17)19(27)24-20(25)28;3-2(4,5)1(6)7/h1-6,9,13,22H,7-8,10-11H2,(H,23,26)(H,24,27,28);(H,6,7)/t13-;/m0./s1
Standard InChI Key: HFDNJWSRCJRIEB-ZOWNYOTGSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
12.4353 -11.6223 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.0309 -10.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6219 -11.6197 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7386 -10.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3232 -10.5079 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4495 -10.9157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7418 -9.6899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4614 -13.6726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9157 -14.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1692 -13.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2554 -13.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0542 -12.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4591 -14.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7552 -13.9421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4570 -15.1697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0429 -15.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0451 -14.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3370 -13.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6269 -14.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6289 -15.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3328 -15.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9230 -13.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9210 -13.1217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6311 -12.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6332 -11.8977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9252 -11.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2151 -11.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5112 -11.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8010 -11.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7989 -12.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5069 -13.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2171 -12.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9273 -10.6701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3391 -13.1253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7494 -15.5809 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
2 4 1 0
2 5 1 0
4 6 1 0
4 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
8 12 1 0
13 14 1 0
13 15 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
23 32 1 0
27 32 2 0
26 33 2 0
24 34 2 0
22 23 1 0
19 22 1 0
14 17 1 0
10 13 1 1
16 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.30Molecular Weight (Monoisotopic): 442.0641AlogP: 2.05#Rotatable Bonds: 4Polar Surface Area: 95.99Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: 10.55CX LogP: 1.04CX LogD: -0.69Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -1.39
References 1. Zhao H, Ji M, Cui G, Zhou J, Lai F, Chen X, Xu B.. (2017) Discovery of novel quinazoline-2,4(1H,3H)-dione derivatives as potent PARP-2 selective inhibitors., 25 (15): [PMID:28622906 ] [10.1016/j.bmc.2017.05.052 ]