5-methyl-N-(4-(1-methyl-1H-imidazol-2-ylthio)phenyl)-3-phenylisoxazole-4-carboxamide

ID: ALA4092074

PubChem CID: 17558900

Max Phase: Preclinical

Molecular Formula: C21H18N4O2S

Molecular Weight: 390.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1onc(-c2ccccc2)c1C(=O)Nc1ccc(Sc2nccn2C)cc1

Standard InChI:  InChI=1S/C21H18N4O2S/c1-14-18(19(24-27-14)15-6-4-3-5-7-15)20(26)23-16-8-10-17(11-9-16)28-21-22-12-13-25(21)2/h3-13H,1-2H3,(H,23,26)

Standard InChI Key:  ASROFARIZCESSG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    6.3848   -9.2739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2020   -9.2739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4564   -8.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7934   -8.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1346   -8.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2339   -8.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7921   -7.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4992   -6.7882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0838   -6.7904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4980   -5.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2041   -5.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7849   -4.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7893   -5.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3573   -8.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1904   -7.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4139   -7.1947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8059   -7.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9796   -8.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7559   -8.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4894   -4.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1991   -4.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4864   -3.5226    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.1925   -3.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9400   -3.4415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4846   -2.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0733   -2.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2747   -2.2990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1127   -4.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  4  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 21  1  0
 20 12  1  0
 12 13  2  0
 13 10  1  0
  5 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 24 28  1  0
M  END

Associated Targets(non-human)

Gata4 GATA4/NKX2-5 (206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.47Molecular Weight (Monoisotopic): 390.1150AlogP: 4.79#Rotatable Bonds: 5
Polar Surface Area: 72.95Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.49CX Basic pKa: 4.77CX LogP: 4.64CX LogD: 4.64
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: -2.08

References

1. Välimäki MJ, Tölli MA, Kinnunen SM, Aro J, Serpi R, Pohjolainen L, Talman V, Poso A, Ruskoaho HJ..  (2017)  Discovery of Small Molecules Targeting the Synergy of Cardiac Transcription Factors GATA4 and NKX2-5.,  60  (18): [PMID:28858485] [10.1021/acs.jmedchem.7b00816]

Source