The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2-chloro-6-fluorobenzyl)thio)-1-(4-fluorophenyl)-7-(3-methoxyphenyl)-4,5,6,7-tetrahydro-1H-benzo[d]imidazole ID: ALA4092168
PubChem CID: 118464823
Max Phase: Preclinical
Molecular Formula: C27H23ClF2N2OS
Molecular Weight: 497.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C2CCCc3nc(SCc4c(F)cccc4Cl)n(-c4ccc(F)cc4)c32)c1
Standard InChI: InChI=1S/C27H23ClF2N2OS/c1-33-20-6-2-5-17(15-20)21-7-3-10-25-26(21)32(19-13-11-18(29)12-14-19)27(31-25)34-16-22-23(28)8-4-9-24(22)30/h2,4-6,8-9,11-15,21H,3,7,10,16H2,1H3
Standard InChI Key: YTELBMUUMCZECB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
12.2213 -7.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7446 -8.4027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9619 -8.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9617 -7.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7376 -7.0761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2464 -6.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5394 -7.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5438 -8.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2531 -8.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2531 -9.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5483 -9.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5562 -10.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2639 -11.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9708 -10.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9665 -9.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8550 -11.0318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8550 -11.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9993 -9.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4506 -9.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7094 -10.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5128 -10.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0574 -10.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8027 -9.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7674 -11.5185 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.0117 -7.7189 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.4299 -6.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2463 -6.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6943 -7.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5001 -7.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8874 -6.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4501 -6.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6192 -6.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2106 -5.5560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.2858 -8.3945 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
1 5 2 0
6 7 1 0
7 8 1 0
8 9 1 0
3 9 1 0
4 6 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
12 16 1 0
9 10 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
21 24 1 0
2 18 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
32 33 1 0
28 34 1 0
25 26 1 0
1 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.01Molecular Weight (Monoisotopic): 496.1188AlogP: 7.57#Rotatable Bonds: 6Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.35CX LogP: 7.99CX LogD: 7.99Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -1.57
References 1. Zhang X, Wall M, Sui Z, Kauffman J, Hou C, Chen C, Du F, Kirchner T, Liang Y, Johnson DL, Murray WV, Demarest K.. (2017) Discovery of Orally Efficacious Tetrahydrobenzimidazoles as TGR5 Agonists for Type 2 Diabetes., 8 (5): [PMID:28523111 ] [10.1021/acsmedchemlett.7b00116 ]