The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((3-phenylpropyl)amino)-7-((1-(2-(6,7-dihydroxyquinolin-4-ylamino)ethyl)piperidin-4-yl)methoxy)quinazoline ID: ALA4092207
PubChem CID: 137653196
Max Phase: Preclinical
Molecular Formula: C34H38N6O3
Molecular Weight: 578.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Oc1cc2nccc(NCCN3CCC(COc4ccc5c(NCCCc6ccccc6)ncnc5c4)CC3)c2cc1O
Standard InChI: InChI=1S/C34H38N6O3/c41-32-20-28-29(10-14-35-31(28)21-33(32)42)36-15-18-40-16-11-25(12-17-40)22-43-26-8-9-27-30(19-26)38-23-39-34(27)37-13-4-7-24-5-2-1-3-6-24/h1-3,5-6,8-10,14,19-21,23,25,41-42H,4,7,11-13,15-18,22H2,(H,35,36)(H,37,38,39)
Standard InChI Key: WPQRJAJQHYUQLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
46.9098 -4.2001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.6236 -3.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.6208 -2.9680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.9080 -2.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2018 -3.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2040 -2.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4981 -2.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7894 -2.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7911 -3.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4976 -4.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.9045 -1.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.1951 -1.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4891 -1.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7797 -1.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0737 -1.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3673 -1.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6618 -1.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6649 -2.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3793 -2.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0819 -2.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0844 -4.2030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3757 -3.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6689 -4.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9620 -3.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2574 -4.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2551 -5.0204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9636 -5.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6744 -5.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5468 -5.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8397 -5.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1314 -5.4260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4243 -5.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0082 -4.1982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0097 -5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7207 -5.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7200 -3.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4267 -4.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1345 -3.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1368 -2.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4254 -2.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7205 -2.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4243 -1.7507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8448 -2.5698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
9 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 37 2 0
36 33 2 0
33 34 1 0
34 35 2 0
35 32 1 0
36 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
40 42 1 0
39 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.72Molecular Weight (Monoisotopic): 578.3005AlogP: 5.84#Rotatable Bonds: 12Polar Surface Area: 115.66Molecular Species: BASEHBA: 9HBD: 4#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.54CX Basic pKa: 11.89CX LogP: 3.11CX LogD: 2.54Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -0.90
References 1. Halby L, Menon Y, Rilova E, Pechalrieu D, Masson V, Faux C, Bouhlel MA, David-Cordonnier MH, Novosad N, Aussagues Y, Samson A, Lacroix L, Ausseil F, Fleury L, Guianvarc'h D, Ferroud C, Arimondo PB.. (2017) Rational Design of Bisubstrate-Type Analogues as Inhibitors of DNA Methyltransferases in Cancer Cells., 60 (11): [PMID:28463515 ] [10.1021/acs.jmedchem.7b00176 ]