7(E)-[(2-Furyl)methylene]naltrexone

ID: ALA4092231

PubChem CID: 137654182

Max Phase: Preclinical

Molecular Formula: C25H25NO5

Molecular Weight: 419.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1/C(=C/c2ccco2)C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5

Standard InChI:  InChI=1S/C25H25NO5/c27-18-6-5-15-11-19-25(29)12-16(10-17-2-1-9-30-17)21(28)23-24(25,20(15)22(18)31-23)7-8-26(19)13-14-3-4-14/h1-2,5-6,9-10,14,19,23,27,29H,3-4,7-8,11-13H2/b16-10+/t19-,23+,24+,25-/m1/s1

Standard InChI Key:  QEDBJCANPFBHAG-JCJKLZQWSA-N

Molfile:  

     RDKit          2D

 33 39  0  0  0  0  0  0  0  0999 V2000
   24.6726  -12.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0812  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8554  -12.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0688  -12.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4592  -12.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2268  -13.3640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6478  -10.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6726   -9.9507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4592  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8554  -10.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2516  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8984  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8860  -12.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0812   -9.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6420  -12.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2516  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8984   -9.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6124   -9.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6041   -8.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6420  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3070  -12.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4898  -10.7556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2946  -13.6033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2293  -12.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2210  -13.5992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3618  -10.3593    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.0688  -13.7891    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.1241  -12.1848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5373  -11.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3498  -11.3976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5249  -10.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8199  -10.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2091  -10.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  1  1  0
  5  3  2  0
  6  4  1  0
  7  2  1  0
  8 16  1  0
  9  3  1  0
 10  9  1  0
  1 11  1  1
 12  2  1  0
 13  4  1  0
 14  8  1  0
 15  5  1  0
 16 11  1  0
 17 14  1  0
 18 17  1  0
 19 17  1  0
 20  9  2  0
 21 13  1  0
  2 22  1  1
 23 13  2  0
 24 20  1  0
 25 15  1  0
  7 26  1  6
  4 27  1  1
  5  6  1  0
  8  7  1  0
 21 12  1  0
 10  7  1  0
 24 15  2  0
 18 19  1  0
 21 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4092231

    ---

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.48Molecular Weight (Monoisotopic): 419.1733AlogP: 2.81#Rotatable Bonds: 3
Polar Surface Area: 83.14Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.10CX Basic pKa: 8.84CX LogP: 2.50CX LogD: 1.30
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.74Np Likeness Score: 0.90

References

1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H..  (2017)  Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives.,  25  (16): [PMID:28662966] [10.1016/j.bmc.2017.06.026]

Source