The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7(E)-[(2-Furyl)methylene]naltrexone ID: ALA4092231
PubChem CID: 137654182
Max Phase: Preclinical
Molecular Formula: C25H25NO5
Molecular Weight: 419.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2ccco2)C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5
Standard InChI: InChI=1S/C25H25NO5/c27-18-6-5-15-11-19-25(29)12-16(10-17-2-1-9-30-17)21(28)23-24(25,20(15)22(18)31-23)7-8-26(19)13-14-3-4-14/h1-2,5-6,9-10,14,19,23,27,29H,3-4,7-8,11-13H2/b16-10+/t19-,23+,24+,25-/m1/s1
Standard InChI Key: QEDBJCANPFBHAG-JCJKLZQWSA-N
Molfile:
RDKit 2D
33 39 0 0 0 0 0 0 0 0999 V2000
24.6726 -12.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0812 -11.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8554 -12.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0688 -12.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4592 -12.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2268 -13.3640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6478 -10.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6726 -9.9507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4592 -11.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8554 -10.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2516 -11.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8984 -11.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8860 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0812 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6420 -12.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2516 -10.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8984 -9.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6124 -9.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6041 -8.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6420 -11.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3070 -12.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4898 -10.7556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2946 -13.6033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2293 -12.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2210 -13.5992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3618 -10.3593 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.0688 -13.7891 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.1241 -12.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5373 -11.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3498 -11.3976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5249 -10.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8199 -10.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2091 -10.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 2 0
6 4 1 0
7 2 1 0
8 16 1 0
9 3 1 0
10 9 1 0
1 11 1 1
12 2 1 0
13 4 1 0
14 8 1 0
15 5 1 0
16 11 1 0
17 14 1 0
18 17 1 0
19 17 1 0
20 9 2 0
21 13 1 0
2 22 1 1
23 13 2 0
24 20 1 0
25 15 1 0
7 26 1 6
4 27 1 1
5 6 1 0
8 7 1 0
21 12 1 0
10 7 1 0
24 15 2 0
18 19 1 0
21 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.48Molecular Weight (Monoisotopic): 419.1733AlogP: 2.81#Rotatable Bonds: 3Polar Surface Area: 83.14Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.10CX Basic pKa: 8.84CX LogP: 2.50CX LogD: 1.30Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.74Np Likeness Score: 0.90
References 1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H.. (2017) Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives., 25 (16): [PMID:28662966 ] [10.1016/j.bmc.2017.06.026 ]