1beta,2alpha,8beta-Triacetoxy-9beta-benzoyloxy-beta-dihydroagarofuran

ID: ALA4092298

PubChem CID: 132526822

Max Phase: Preclinical

Molecular Formula: C28H36O9

Molecular Weight: 516.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1[C@@H]2C[C@]3(OC2(C)C)[C@H](C)C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@]3(C)[C@H]1OC(=O)c1ccccc1

Standard InChI:  InChI=1S/C28H36O9/c1-15-13-21(33-16(2)29)23(35-18(4)31)27(7)24(36-25(32)19-11-9-8-10-12-19)22(34-17(3)30)20-14-28(15,27)37-26(20,5)6/h8-12,15,20-24H,13-14H2,1-7H3/t15-,20+,21+,22+,23-,24+,27+,28+/m1/s1

Standard InChI Key:  KSLGVDVBGRMNIV-JZCCXIFMSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    7.4006  -24.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6230  -24.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8326  -24.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8419  -22.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8419  -23.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5391  -23.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5391  -22.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2321  -22.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2337  -23.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9294  -23.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6262  -23.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6246  -22.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9262  -22.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5391  -21.2631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1434  -22.0732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4444  -22.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7458  -22.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4480  -23.2856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8382  -20.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8382  -20.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1415  -21.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9229  -21.2646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6221  -20.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3204  -21.2589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6188  -20.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3182  -19.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3155  -18.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6163  -18.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9177  -18.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9216  -19.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3253  -22.0712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0222  -22.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7228  -22.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0225  -23.2802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5387  -24.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2314  -24.0862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4053  -23.4898    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2251  -21.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  7  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7 14  1  1
  4 15  1  6
 15 16  1  0
 16 17  1  0
 16 18  2  0
 14 19  1  0
 19 20  2  0
 19 21  1  0
 13 22  1  1
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 12 31  1  1
 31 32  1  0
 32 33  1  0
 32 34  2  0
  6 35  1  6
  9 36  1  1
 11  2  1  0
 36  2  1  0
 11 37  1  6
  8 38  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4092298

    ---

Associated Targets(non-human)

Caenorhabditis elegans (1055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.59Molecular Weight (Monoisotopic): 516.2359AlogP: 3.62#Rotatable Bonds: 5
Polar Surface Area: 114.43Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.21CX LogD: 3.21
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: 2.24

References

1. Gao L, Zhang R, Lan J, Ning R, Wu D, Chen D, Zhao W..  (2016)  β-Dihydroagarofuran-Type Sesquiterpenes from the Seeds of Celastrus monospermus and Their Lifespan-Extending Effects on the Nematode Caenorhabditis elegans.,  79  (12): [PMID:28006915] [10.1021/acs.jnatprod.6b00648]

Source