The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3alpha-Hydroxy-5beta-cholan-24-oyl)-gamma-aminobutanoic acid ID: ALA4092329
PubChem CID: 137653935
Max Phase: Preclinical
Molecular Formula: C28H47NO4
Molecular Weight: 461.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCC(=O)NCCCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C28H47NO4/c1-18(6-11-25(31)29-16-4-5-26(32)33)22-9-10-23-21-8-7-19-17-20(30)12-14-27(19,2)24(21)13-15-28(22,23)3/h18-24,30H,4-17H2,1-3H3,(H,29,31)(H,32,33)/t18-,19-,20-,21+,22-,23+,24+,27+,28-/m1/s1
Standard InChI Key: OQXPELKQNWQUKY-CUYCEIPOSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
3.7517 -21.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7517 -22.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4569 -23.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4569 -21.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1622 -21.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1633 -22.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8676 -23.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5754 -22.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8655 -21.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5762 -21.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 -20.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8618 -20.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2857 -20.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2827 -21.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0631 -21.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5486 -21.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0681 -20.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0445 -23.1176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1549 -21.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1590 -23.5211 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.8607 -22.2953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5705 -21.0695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2763 -22.2994 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2804 -19.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3235 -19.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1235 -19.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7790 -19.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6680 -20.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4680 -19.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0125 -20.5192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7234 -19.1337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8529 -20.1945 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.8125 -20.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3570 -20.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1570 -20.7948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7015 -21.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5015 -21.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4461 -22.1803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
2 18 1 6
5 19 1 1
6 20 1 1
9 21 1 6
10 22 1 1
14 23 1 6
13 24 1 1
17 25 1 0
25 26 1 0
25 27 1 6
26 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
17 32 1 6
30 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.69Molecular Weight (Monoisotopic): 461.3505AlogP: 5.40#Rotatable Bonds: 8Polar Surface Area: 86.63Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.30CX Basic pKa: ┄CX LogP: 4.44CX LogD: 1.48Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: 1.66
References 1. Incerti M, Russo S, Callegari D, Pala D, Giorgio C, Zanotti I, Barocelli E, Vicini P, Vacondio F, Rivara S, Castelli R, Tognolini M, Lodola A.. (2017) Metadynamics for Perspective Drug Design: Computationally Driven Synthesis of New Protein-Protein Interaction Inhibitors Targeting the EphA2 Receptor., 60 (2): [PMID:28005388 ] [10.1021/acs.jmedchem.6b01642 ]