2-(Furan-2-yl)-3-(6-(2-(furan-2-yl-methylene)hydrazinyl)hexanoyl)-2,3-dihydroquinazolin-4(1H)-one

ID: ALA4092475

PubChem CID: 137656032

Max Phase: Preclinical

Molecular Formula: C23H24N4O4

Molecular Weight: 420.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCCCCN1C(=O)c2ccccc2NC1c1ccco1)N/N=C/c1ccco1

Standard InChI:  InChI=1S/C23H24N4O4/c28-21(26-24-16-17-8-6-14-30-17)12-2-1-5-13-27-22(20-11-7-15-31-20)25-19-10-4-3-9-18(19)23(27)29/h3-4,6-11,14-16,22,25H,1-2,5,12-13H2,(H,26,28)/b24-16+

Standard InChI Key:  ULMJWIVDSBMLQT-LFVJCYFKSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    9.0177   -8.2084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7254   -7.7998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4331   -8.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1408   -7.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6565   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6554   -5.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3634   -5.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3616   -4.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0702   -4.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0691   -5.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7753   -5.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4872   -5.3383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4883   -4.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7776   -4.1041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7730   -6.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1970   -4.1108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1937   -5.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1914   -6.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8980   -6.9766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6069   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3134   -6.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3111   -7.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6023   -8.2044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9430   -4.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4913   -3.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0843   -3.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2847   -3.3033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8874   -8.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4342   -7.5207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0256   -6.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2263   -6.9830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 11 15  2  0
 13 16  1  0
 12 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22  1  1  0
 22 23  2  0
 16 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 16  1  0
  4 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31  4  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4092475

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 420.47Molecular Weight (Monoisotopic): 420.1798AlogP: 4.15#Rotatable Bonds: 9
Polar Surface Area: 100.08Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.33CX Basic pKa: CX LogP: 3.62CX LogD: 3.62
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -1.33

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source