4-(4-(N-allyl-4,5-dibromo-1H-pyrrole-2-carboxamido)piperidin-1-yl)-4-oxobutanoic acid

ID: ALA4092560

PubChem CID: 137656035

Max Phase: Preclinical

Molecular Formula: C17H21Br2N3O4

Molecular Weight: 491.18

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCN(C(=O)c1cc(Br)c(Br)[nH]1)C1CCN(C(=O)CCC(=O)O)CC1

Standard InChI:  InChI=1S/C17H21Br2N3O4/c1-2-7-22(17(26)13-10-12(18)16(19)20-13)11-5-8-21(9-6-11)14(23)3-4-15(24)25/h2,10-11,20H,1,3-9H2,(H,24,25)

Standard InChI Key:  VICGAIIHQSGINJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   10.7621   -8.1775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8852   -6.9517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8852   -7.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1803   -8.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4712   -7.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4712   -6.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1803   -6.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5943   -6.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5943   -5.7259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3018   -6.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0547   -7.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7614   -8.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4687   -9.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3467   -8.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0554   -6.9511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6029   -7.8447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2631   -8.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4637   -9.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0576   -8.4514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0097   -6.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7173   -6.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4251   -6.5443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7169   -7.7698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4681  -10.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2450   -8.3650    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    8.1299   -9.9056    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  2  7  1  0
  8  9  2  0
  2  8  1  0
  1  5  1  0
  8 10  1  0
  1 11  1  0
  1 12  1  0
 12 13  1  0
 11 14  1  0
 11 15  2  0
 14 16  1  0
 16 19  1  0
 18 17  1  0
 17 14  2  0
 18 19  2  0
 10 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 13 24  2  0
 19 25  1  0
 18 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4092560

    ---

Associated Targets(non-human)

gyrB DNA gyrase subunit B (290 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
gyrB DNA gyrase subunit B (542 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.18Molecular Weight (Monoisotopic): 488.9899AlogP: 3.02#Rotatable Bonds: 7
Polar Surface Area: 93.71Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.29CX Basic pKa: CX LogP: 1.32CX LogD: -1.65
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.57Np Likeness Score: -0.75

References

1. Jukič M, Ilaš J, Brvar M, Kikelj D, Cesar J, Anderluh M..  (2017)  Linker-switch approach towards new ATP binding site inhibitors of DNA gyrase B.,  125  [PMID:27689732] [10.1016/j.ejmech.2016.09.040]

Source