3-(2,6-difluorobenzylthio)-5-(3,4-dimethoxybenzyl)-4-(4-fluorophenyl)-4H-1,2,4-triazole

ID: ALA4092629

PubChem CID: 66740913

Max Phase: Preclinical

Molecular Formula: C24H20F3N3O2S

Molecular Weight: 471.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cc2nnc(SCc3c(F)cccc3F)n2-c2ccc(F)cc2)cc1OC

Standard InChI:  InChI=1S/C24H20F3N3O2S/c1-31-21-11-6-15(12-22(21)32-2)13-23-28-29-24(30(23)17-9-7-16(25)8-10-17)33-14-18-19(26)4-3-5-20(18)27/h3-12H,13-14H2,1-2H3

Standard InChI Key:  QYTVXMFHESIMAM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    7.3832  -14.9694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5660  -14.9653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3096  -15.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9683  -16.2249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6318  -15.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4077  -16.0043    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.0177  -15.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7936  -15.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9572  -16.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7323  -16.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3433  -16.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1740  -15.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3991  -15.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5311  -15.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9266  -15.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -14.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4976  -14.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7182  -14.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5459  -15.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1509  -15.6927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7683  -15.3978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1618  -14.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1129  -13.7943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2859  -12.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3462  -17.0609    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.2305  -14.3746    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.9634  -17.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2521  -17.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2476  -18.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9538  -18.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6659  -18.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6669  -17.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9508  -19.4901    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 18 23  1  0
 23 24  1  0
  9 25  1  0
 13 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  4 27  1  0
 30 33  1  0
M  END

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpbar1 G-protein coupled bile acid receptor 1 (577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.50Molecular Weight (Monoisotopic): 471.1228AlogP: 5.58#Rotatable Bonds: 8
Polar Surface Area: 49.17Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.53CX LogP: 5.78CX LogD: 5.78
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.75

References

1. Lasalle M, Hoguet V, Hennuyer N, Leroux F, Piveteau C, Belloy L, Lestavel S, Vallez E, Dorchies E, Duplan I, Sevin E, Culot M, Gosselet F, Boulahjar R, Herledan A, Staels B, Deprez B, Tailleux A, Charton J..  (2017)  Topical Intestinal Aminoimidazole Agonists of G-Protein-Coupled Bile Acid Receptor 1 Promote Glucagon Like Peptide-1 Secretion and Improve Glucose Tolerance.,  60  (10): [PMID:28414465] [10.1021/acs.jmedchem.6b01873]

Source