The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2,6-difluorobenzylthio)-5-(3,4-dimethoxybenzyl)-4-(4-fluorophenyl)-4H-1,2,4-triazole ID: ALA4092629
PubChem CID: 66740913
Max Phase: Preclinical
Molecular Formula: C24H20F3N3O2S
Molecular Weight: 471.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nnc(SCc3c(F)cccc3F)n2-c2ccc(F)cc2)cc1OC
Standard InChI: InChI=1S/C24H20F3N3O2S/c1-31-21-11-6-15(12-22(21)32-2)13-23-28-29-24(30(23)17-9-7-16(25)8-10-17)33-14-18-19(26)4-3-5-20(18)27/h3-12H,13-14H2,1-2H3
Standard InChI Key: QYTVXMFHESIMAM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.3832 -14.9694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5660 -14.9653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3096 -15.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9683 -16.2249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6318 -15.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4077 -16.0043 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0177 -15.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7936 -15.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9572 -16.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7323 -16.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3433 -16.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1740 -15.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3991 -15.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5311 -15.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9266 -15.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1013 -14.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4976 -14.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7182 -14.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5459 -15.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1509 -15.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7683 -15.3978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1618 -14.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1129 -13.7943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2859 -12.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3462 -17.0609 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.2305 -14.3746 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.9634 -17.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2521 -17.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2476 -18.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9538 -18.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6659 -18.2635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6669 -17.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9508 -19.4901 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
9 25 1 0
13 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
4 27 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.50Molecular Weight (Monoisotopic): 471.1228AlogP: 5.58#Rotatable Bonds: 8Polar Surface Area: 49.17Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.53CX LogP: 5.78CX LogD: 5.78Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.75
References 1. Lasalle M, Hoguet V, Hennuyer N, Leroux F, Piveteau C, Belloy L, Lestavel S, Vallez E, Dorchies E, Duplan I, Sevin E, Culot M, Gosselet F, Boulahjar R, Herledan A, Staels B, Deprez B, Tailleux A, Charton J.. (2017) Topical Intestinal Aminoimidazole Agonists of G-Protein-Coupled Bile Acid Receptor 1 Promote Glucagon Like Peptide-1 Secretion and Improve Glucose Tolerance., 60 (10): [PMID:28414465 ] [10.1021/acs.jmedchem.6b01873 ]