4-((6-(3-cyclopentylureido)-1H-indazol-1-yl)methyl)-3-methoxy-N-(phenylsulfonyl)benzamide

ID: ALA4092741

PubChem CID: 137656046

Max Phase: Preclinical

Molecular Formula: C28H29N5O5S

Molecular Weight: 547.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)NS(=O)(=O)c2ccccc2)ccc1Cn1ncc2ccc(NC(=O)NC3CCCC3)cc21

Standard InChI:  InChI=1S/C28H29N5O5S/c1-38-26-15-19(27(34)32-39(36,37)24-9-3-2-4-10-24)11-12-21(26)18-33-25-16-23(14-13-20(25)17-29-33)31-28(35)30-22-7-5-6-8-22/h2-4,9-17,22H,5-8,18H2,1H3,(H,32,34)(H2,30,31,35)

Standard InChI Key:  NRXNEFTTXFSSDD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   25.8158  -22.5058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1101  -22.0972    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.1091  -22.9127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1171  -20.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1160  -20.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8240  -21.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8222  -19.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5308  -20.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5356  -20.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3157  -21.1094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7930  -20.4442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3079  -19.7849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5727  -21.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3730  -22.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6248  -22.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4243  -22.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9685  -22.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7076  -21.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9088  -21.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0796  -23.4348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2798  -23.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7690  -22.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0271  -23.3203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3115  -21.9337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6545  -21.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4552  -21.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9974  -21.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7395  -20.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9343  -20.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3956  -20.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4079  -21.2735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7006  -20.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9925  -21.2724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7012  -20.0471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2851  -20.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2005  -20.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4013  -19.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9921  -20.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5385  -21.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 10 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 15 20  1  0
 20 21  1  0
 17 22  1  0
 22 23  2  0
 22 24  1  0
 24  2  1  0
  2 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  5 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4092741

    ---

Associated Targets(non-human)

Canis familiaris (36305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.64Molecular Weight (Monoisotopic): 547.1889AlogP: 4.28#Rotatable Bonds: 8
Polar Surface Area: 131.42Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.28CX Basic pKa: 1.09CX LogP: 3.92CX LogD: 2.98
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -1.65

References

1. Proschak E, Heitel P, Kalinowsky L, Merk D..  (2017)  Opportunities and Challenges for Fatty Acid Mimetics in Drug Discovery.,  60  (13): [PMID:28252961] [10.1021/acs.jmedchem.6b01287]

Source