The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S*)-2-((2-chloro-6-fluorobenzyl)thio)-7-(3,4-dimethoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-benzo[d]imidazole ID: ALA4092785
PubChem CID: 118464680
Max Phase: Preclinical
Molecular Formula: C28H25ClF2N2O2S
Molecular Weight: 527.04
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H]2CCCc3nc(SCc4c(F)cccc4Cl)n(-c4ccc(F)cc4)c32)cc1OC
Standard InChI: InChI=1S/C28H25ClF2N2O2S/c1-34-25-14-9-17(15-26(25)35-2)20-5-3-8-24-27(20)33(19-12-10-18(30)11-13-19)28(32-24)36-16-21-22(29)6-4-7-23(21)31/h4,6-7,9-15,20H,3,5,8,16H2,1-2H3/t20-/m0/s1
Standard InChI Key: DSZKDRPMIXOLCO-FQEVSTJZSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
9.8898 -5.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4018 -6.1608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6235 -5.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6332 -5.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4135 -4.8343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9249 -4.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2110 -5.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2053 -5.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9088 -6.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6512 -6.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0962 -7.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3415 -8.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1420 -8.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6970 -7.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4517 -7.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3914 -9.2899 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9088 -7.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1899 -7.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1835 -8.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8869 -8.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6065 -8.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6122 -7.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8869 -9.5862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1737 -9.9948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4703 -8.7562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4703 -9.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7111 -5.5090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.1197 -4.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9410 -4.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3496 -5.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1624 -5.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5794 -4.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1752 -4.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3539 -4.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9453 -3.3825 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.9410 -6.2181 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
1 5 2 0
6 7 1 0
7 8 1 0
8 9 1 0
3 9 1 0
4 6 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
13 16 1 0
2 10 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
23 24 1 0
20 23 1 0
25 26 1 0
19 25 1 0
9 17 1 6
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
34 35 1 0
30 36 1 0
27 28 1 0
1 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.04Molecular Weight (Monoisotopic): 526.1293AlogP: 7.58#Rotatable Bonds: 7Polar Surface Area: 36.28Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.35CX LogP: 7.83CX LogD: 7.83Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.37
References 1. Zhang X, Wall M, Sui Z, Kauffman J, Hou C, Chen C, Du F, Kirchner T, Liang Y, Johnson DL, Murray WV, Demarest K.. (2017) Discovery of Orally Efficacious Tetrahydrobenzimidazoles as TGR5 Agonists for Type 2 Diabetes., 8 (5): [PMID:28523111 ] [10.1021/acsmedchemlett.7b00116 ]