The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 3-[2-(2-{4-ethoxy-4-oxobutan-2-ylidene}hydrazinylcarbonyl)ethyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate ID: ALA4092868
PubChem CID: 137653725
Max Phase: Preclinical
Molecular Formula: C23H29N5O8
Molecular Weight: 503.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C/C(C)=N\NC(=O)CCN1C(=O)NC(C)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C23H29N5O8/c1-5-35-19(30)12-14(3)25-26-18(29)10-11-27-21(16-8-7-9-17(13-16)28(33)34)20(22(31)36-6-2)15(4)24-23(27)32/h7-9,13,21H,5-6,10-12H2,1-4H3,(H,24,32)(H,26,29)/b25-14-
Standard InChI Key: AMEMCYRSYUHAEH-QFEZKATASA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
10.8136 -7.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8226 -6.9637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1201 -6.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4086 -6.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3997 -7.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1022 -8.1822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7061 -6.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9906 -6.9349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7151 -5.7164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5161 -8.2007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1290 -5.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8405 -5.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8494 -4.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1469 -4.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4355 -4.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4265 -5.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5609 -4.1110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2633 -4.5309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5698 -3.2939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6882 -8.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5340 -6.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2406 -6.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9521 -6.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9610 -5.7637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6546 -6.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3660 -6.5953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7799 -6.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0685 -7.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0595 -7.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7620 -8.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4776 -7.8425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7572 -9.0610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4597 -9.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4508 -10.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0085 -5.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0174 -4.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
4 7 1 0
1 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 2 0
17 19 1 0
13 17 1 0
3 11 1 0
5 20 1 0
21 22 1 0
23 24 2 0
25 26 1 0
23 25 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
33 34 1 0
32 33 1 0
30 32 1 0
26 28 2 0
22 23 1 0
2 21 1 0
35 36 1 0
9 35 1 0
M CHG 2 17 1 19 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.51Molecular Weight (Monoisotopic): 503.2016AlogP: 2.33#Rotatable Bonds: 11Polar Surface Area: 169.54Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.80CX Basic pKa: 0.90CX LogP: 1.27CX LogD: 1.27Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -1.37
References 1. Teleb M, Zhang FX, Huang J, Gadotti VM, Farghaly AM, AboulWafa OM, Zamponi GW, Fahmy H.. (2017) Synthesis and biological evaluation of novel N3-substituted dihydropyrimidine derivatives as T-type calcium channel blockers and their efficacy as analgesics in mouse models of inflammatory pain., 25 (6): [PMID:28233679 ] [10.1016/j.bmc.2017.02.015 ]