The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N'-(3,5-bis(trifluoromethyl)phenyl)-2-(5-(4-methoxyphenyl)isoxazol-3-yl)-2-oxoacetohydrazonoyl cyanide ID: ALA4092921
PubChem CID: 137656054
Max Phase: Preclinical
Molecular Formula: C21H12F6N4O3
Molecular Weight: 482.34
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(C(=O)/C(C#N)=N/Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)no2)cc1
Standard InChI: InChI=1S/C21H12F6N4O3/c1-33-15-4-2-11(3-5-15)18-9-16(31-34-18)19(32)17(10-28)30-29-14-7-12(20(22,23)24)6-13(8-14)21(25,26)27/h2-9,29H,1H3/b30-17+
Standard InChI Key: OPHHSQOWPLYZDG-OCSSWDANSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
2.1791 -25.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1780 -25.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8933 -26.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6103 -25.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6074 -25.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8915 -24.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8891 -23.9195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6028 -23.5070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6004 -22.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3142 -22.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3117 -21.4404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0262 -22.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1156 -23.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9191 -23.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3315 -22.9482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7762 -22.3358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8810 -22.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1648 -21.8643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2587 -24.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7723 -25.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1119 -25.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9334 -25.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4143 -25.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0762 -24.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3259 -26.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3272 -27.2204 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0362 -25.9839 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0327 -26.8093 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4627 -26.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7480 -25.9856 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4621 -27.2214 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7421 -26.8052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2718 -26.6707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7934 -27.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
17 18 3 0
9 17 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
14 19 1 0
4 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
2 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
22 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.34Molecular Weight (Monoisotopic): 482.0814AlogP: 5.56#Rotatable Bonds: 6Polar Surface Area: 100.51Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.49CX Basic pKa: ┄CX LogP: 6.03CX LogD: 4.32Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: -1.30
References 1. Ye N, Zhu Y, Liu Z, Mei FC, Chen H, Wang P, Cheng X, Zhou J.. (2017) Identification of novel 2-(benzo[d]isoxazol-3-yl)-2-oxo-N-phenylacetohydrazonoyl cyanide analoguesas potent EPAC antagonists., 134 [PMID:28399451 ] [10.1016/j.ejmech.2017.04.001 ]