(4-(5-chloro-1H-indol-2-ylsulfonyl)piperazin-1-yl)(4-(pyridin-4-yl)phenyl)methanone

ID: ALA4092958

PubChem CID: 9872994

Max Phase: Preclinical

Molecular Formula: C24H21ClN4O3S

Molecular Weight: 480.98

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(-c2ccncc2)cc1)N1CCN(S(=O)(=O)c2cc3cc(Cl)ccc3[nH]2)CC1

Standard InChI:  InChI=1S/C24H21ClN4O3S/c25-21-5-6-22-20(15-21)16-23(27-22)33(31,32)29-13-11-28(12-14-29)24(30)19-3-1-17(2-4-19)18-7-9-26-10-8-18/h1-10,15-16,27H,11-14H2

Standard InChI Key:  QUWXNGCXFLZUFK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   43.0223   -9.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8477   -9.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2624   -9.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8477  -10.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2624  -11.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0836  -11.1996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.4985  -10.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0836   -9.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2624   -8.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8477   -7.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0223   -7.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6116   -6.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0223   -6.1990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.7863   -6.9123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.3757   -7.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5504   -7.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1355   -6.9123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.3101   -6.9123    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.8995   -6.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2333   -5.4464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6194   -4.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9062   -5.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1930   -4.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1930   -4.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9061   -3.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6194   -4.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4798   -3.6586    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   38.0806   -6.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5950   -7.3281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3101   -7.7376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5504   -6.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3757   -6.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6116   -8.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  3  8  1  0
  9  2  1  0
 10  9  2  0
 11 10  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 21 20  1  0
 22 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 28 22  1  0
 19 28  2  0
 18 29  2  0
 18 30  2  0
 31 17  1  0
 32 31  1  0
 14 32  1  0
 33 11  2  0
  1 33  1  0
M  END

Associated Targets(Human)

ABCB11 Tchem Bile salt export pump (2311 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.98Molecular Weight (Monoisotopic): 480.1023AlogP: 4.03#Rotatable Bonds: 4
Polar Surface Area: 86.37Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.63CX Basic pKa: 4.94CX LogP: 3.18CX LogD: 3.17
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.42

References

1. Warner DJ, Chen H, Cantin LD, Kenna JG, Stahl S, Walker CL, Noeske T..  (2012)  Mitigating the inhibition of human bile salt export pump by drugs: opportunities provided by physicochemical property modulation, in silico modeling, and structural modification.,  40  (12): [PMID:22961681] [10.1124/dmd.112.047068]

Source