N-[2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxamide

ID: ALA4093111

PubChem CID: 137656064

Max Phase: Preclinical

Molecular Formula: C25H24BF3N2O4

Molecular Weight: 484.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)OB(c2ccccc2NC(=O)c2ccc(Oc3ccc(C(F)(F)F)cc3)nc2)OC1(C)C

Standard InChI:  InChI=1S/C25H24BF3N2O4/c1-23(2)24(3,4)35-26(34-23)19-7-5-6-8-20(19)31-22(32)16-9-14-21(30-15-16)33-18-12-10-17(11-13-18)25(27,28)29/h5-15H,1-4H3,(H,31,32)

Standard InChI Key:  NRNVMGADZMCLEL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   15.1799  -14.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1841  -13.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4743  -14.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6988  -14.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9930  -13.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9920  -14.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5883  -13.0516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8749  -12.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8826  -11.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1762  -11.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4663  -11.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4628  -12.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1671  -13.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7502  -11.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4377  -11.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7276  -11.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7219  -12.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0102  -13.0609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3001  -12.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3092  -11.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0209  -11.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4392  -10.6128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1402  -11.8421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8540  -11.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5600  -11.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2738  -11.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2794  -10.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5713  -10.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8576  -10.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2310  -13.1252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5529  -12.6627    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   14.9040  -13.1682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7511  -10.5793    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0420  -11.8043    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0369  -10.9867    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
  7  8  1  0
 11 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 15 22  2  0
 15 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 30 31  1  0
 31 32  1  0
 32  2  1  0
  2  5  1  0
 30  5  1  0
 25 31  1  0
 23 24  1  0
 19  7  1  0
 14 33  1  0
 14 34  1  0
 14 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4093111

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.28Molecular Weight (Monoisotopic): 484.1781AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ogiyama T, Yamaguchi M, Kurikawa N, Honzumi S, Yamamoto Y, Sugiyama D, Takakusa H, Inoue SI..  (2017)  Identification of a novel hormone sensitive lipase inhibitor with a reduced potential of reactive metabolites formation.,  25  (7): [PMID:28279560] [10.1016/j.bmc.2017.02.045]

Source